![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[DIR]](/icons/script.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| czmq/ | 2024-05-25 13:59 | - | |
| cyvcf2/ | 2024-08-02 15:20 | - | |
| cython/ | 2024-08-23 02:57 | - | |
| cython-legacy/ | 2024-04-10 15:02 | - | |
| cysignals/ | 2024-11-01 03:26 | - | |
| cyrus-sasl2/ | 2024-09-08 14:49 | - | |
| cyrus-imspd/ | 2022-12-16 04:27 | - | |
| cyrus-imapd/ | 2024-10-26 20:43 | - | |
| cyrus-imapd-2.4/ | 2018-01-22 16:52 | - | |
| cyphesis-cpp/ | 2020-12-30 07:34 | - | |
| cypari2/ | 2024-04-06 21:48 | - | |
| cynthiune.app/ | 2024-11-01 03:26 | - | |
| cylc/ | 2022-07-24 11:42 | - | |
| cylc-flow/ | 2024-11-01 03:17 | - | |
| cyclonedds/ | 2024-05-18 09:18 | - | |
| cyclograph/ | 2022-08-30 08:09 | - | |
| cycle/ | 2024-11-01 03:17 | - | |
| cycle-quotes/ | 2024-07-27 09:02 | - | |
| cyclades-serial-client/ | 2021-01-25 08:14 | - | |
| cycfx2prog/ | 2024-05-09 19:31 | - | |
| cyborg/ | 2024-11-01 02:51 | - | |
| cyarray/ | 2024-11-01 03:26 | - | |
| cyanrip/ | 2024-08-13 21:02 | - | |
| cxxtools/ | 2024-04-17 02:55 | - | |
| cxxtest/ | 2020-12-30 07:34 | - | |
| cxxopts/ | 2024-05-03 10:40 | - | |
| cxxheaderparser/ | 2024-02-27 00:40 | - | |
| cxref/ | 2024-05-09 19:31 | - | |
| cx-freeze/ | 2016-11-01 16:16 | - | |
| cwm/ | 2022-07-19 08:45 | - | |
| cwltool/ | 2024-11-01 01:13 | - | |
| cwltest/ | 2024-11-01 03:17 | - | |
| cwlformat/ | 2024-05-03 15:55 | - | |
| cwl-utils/ | 2024-11-01 03:17 | - | |
| cwl-upgrader/ | 2024-01-27 14:58 | - | |
| cwirc/ | 2018-01-22 16:52 | - | |
| cwiid/ | 2024-10-26 23:34 | - | |
| cwidget/ | 2024-04-19 06:27 | - | |
| cwebx/ | 2021-01-29 02:09 | - | |
| cweb-latex/ | 2015-04-30 21:21 | - | |
| cwdaemon/ | 2024-05-11 21:59 | - | |
| cvxopt/ | 2024-07-30 16:11 | - | |
| cvsweb/ | 2021-01-05 07:41 | - | |
| cvsutils/ | 2023-10-27 03:36 | - | |
| cvstrac/ | 2016-11-01 02:29 | - | |
| cvsps/ | 2024-05-09 19:31 | - | |
| cvsgraph/ | 2023-10-27 16:05 | - | |
| cvsdelta/ | 2022-04-30 21:22 | - | |
| cvsd/ | 2024-02-18 12:37 | - | |
| cvschangelogbuilder/ | 2017-02-19 14:15 | - | |
| cvs2svn/ | 2020-07-11 05:52 | - | |
| cvs2cl/ | 2018-06-22 23:13 | - | |
| cvs/ | 2024-04-24 08:53 | - | |
| cvs-syncmail/ | 2016-04-07 11:58 | - | |
| cvs-mailcommit/ | 2024-06-15 02:07 | - | |
| cvs-fast-export/ | 2022-07-24 11:42 | - | |
| cvs-buildpackage/ | 2022-05-21 07:35 | - | |
| cvs-autoreleasedeb/ | 2018-01-23 17:15 | - | |
| cvprac/ | 2024-05-18 19:58 | - | |
| cvm/ | 2024-04-04 03:19 | - | |
| cvise/ | 2024-09-13 21:43 | - | |
| cvelib/ | 2023-11-26 13:35 | - | |
| cvector/ | 2024-04-22 23:50 | - | |
| cvc5/ | 2024-05-09 19:31 | - | |
| cvc4/ | 2024-04-05 15:45 | - | |
| cvc3/ | 2020-12-30 07:34 | - | |
| cuyo/ | 2022-11-24 21:39 | - | |
| cutycapt/ | 2024-04-06 21:48 | - | |
| cutter/ | 2020-04-03 04:59 | - | |
| cutter-testing-framework/ | 2016-03-29 14:15 | - | |
| cutmp3/ | 2024-04-11 08:50 | - | |
| cutils/ | 2024-05-14 20:05 | - | |
| cutesv/ | 2024-11-01 03:17 | - | |
| cutesdr/ | 2024-04-06 21:48 | - | |
| cutepaste/ | 2024-04-06 21:48 | - | |
| cutemaze/ | 2024-11-01 03:26 | - | |
| cutefish-core/ | 2024-04-06 21:48 | - | |
| cutecom/ | 2024-04-06 21:48 | - | |
| cutechess/ | 2015-12-05 04:06 | - | |
| customidenticon/ | 2022-11-18 14:35 | - | |
| customdeb/ | 2008-05-09 19:06 | - | |
| custom-printf/ | 2016-01-14 02:00 | - | |
| custodian/ | 2024-08-12 14:59 | - | |
| custodia/ | 2024-05-27 14:15 | - | |
| curvesapi/ | 2021-02-05 20:18 | - | |
| curvedns/ | 2024-04-05 03:15 | - | |
| curtin/ | 2020-07-23 02:17 | - | |
| curtain/ | 2024-04-06 21:48 | - | |
| curseofwar/ | 2020-12-30 07:34 | - | |
| curry-tools/ | 2021-02-05 13:34 | - | |
| curry-libs/ | 2021-02-05 13:19 | - | |
| curry-frontend/ | 2022-08-25 20:34 | - | |
| curry-base/ | 2022-08-24 02:32 | - | |
| curlpp/ | 2024-04-05 15:45 | - | |
| curlftpfs/ | 2024-11-01 02:51 | - | |
| curl3/ | 2018-03-07 15:49 | - | |
| curl/ | 2024-04-15 08:45 | - | |
| cura/ | 2023-07-05 08:29 | - | |
| cura-engine/ | 2024-07-05 02:56 | - | |
| cupt/ | 2024-04-06 21:48 | - | |
| cups/ | 2020-04-29 02:14 | - | |
| cups-x2go/ | 2022-04-30 13:32 | - | |
| cups-pdf/ | 2024-11-01 03:26 | - | |
| cups-browsed/ | 2024-10-21 21:20 | - | |
| cups-bjnp/ | 2024-05-10 00:00 | - | |
| cupp/ | 2020-04-28 04:20 | - | |
| cup/ | 2018-10-10 15:53 | - | |
| cunit/ | 2024-01-20 20:50 | - | |
| cumin/ | 2023-01-15 14:34 | - | |
| cultivation/ | 2024-07-21 17:02 | - | |
| culmus-fancy/ | 2024-06-17 20:54 | - | |
| cuetools/ | 2020-04-03 04:59 | - | |
| cue2toc/ | 2023-06-19 07:39 | - | |
| cudf/ | 2024-09-29 14:47 | - | |
| cucumber/ | 2024-02-24 01:08 | - | |
| cubictemp/ | 2015-10-09 14:23 | - | |
| cubicsdr/ | 2024-07-12 03:22 | - | |
| cubemap/ | 2024-08-12 07:50 | - | |
| cubeb/ | 2024-07-08 15:04 | - | |
| cube2font/ | 2020-12-30 07:34 | - | |
| cube2/ | 2021-04-29 21:42 | - | |
| cube2-data/ | 2021-04-29 20:24 | - | |
| cubature/ | 2024-04-22 23:50 | - | |
| cuba/ | 2015-12-05 04:06 | - | |
| cub/ | 2024-07-05 08:59 | - | |
| cu2qu/ | 2021-02-18 08:18 | - | |
| ctwm/ | 2024-04-06 21:48 | - | |
| ctsim/ | 2024-04-06 21:48 | - | |
| ctpp2/ | 2020-12-30 07:34 | - | |
| ctpl/ | 2024-04-04 03:19 | - | |
| ctorrent/ | 2024-05-09 19:31 | - | |
| ctop/ | 2021-01-03 07:42 | - | |
| ctn/ | 2024-07-24 14:23 | - | |
| ctn-doc/ | 2015-04-30 21:21 | - | |
| ctioga2/ | 2018-04-18 06:48 | - | |
| cthumb/ | 2022-05-21 07:35 | - | |
| cthreadpool/ | 2024-03-24 08:43 | - | |
| ctfutils/ | 2017-04-06 14:44 | - | |
| ctffind/ | 2024-07-20 06:39 | - | |
| ctemplate/ | 2024-04-04 03:19 | - | |
| ctdopts/ | 2024-11-01 03:17 | - | |
| ctdconverter/ | 2024-11-01 03:17 | - | |
| ctdb/ | 2018-01-22 16:52 | - | |
| ctapi/ | 2021-01-08 02:15 | - | |
| csync2/ | 2024-04-05 15:45 | - | |
| csync-owncloud/ | 2015-04-27 02:04 | - | |
| csvkit/ | 2024-11-01 03:17 | - | |
| csvjdbc/ | 2022-06-09 01:50 | - | |
| csvimp/ | 2020-12-30 07:34 | - | |
| csv2latex/ | 2022-11-06 16:22 | - | |
| csv-mode/ | 2024-08-05 21:12 | - | |
| cstream/ | 2023-02-05 08:57 | - | |
| cstore-fdw/ | 2020-12-30 07:34 | - | |
| cstocs/ | 2019-10-26 04:47 | - | |
| cssutils/ | 2024-01-11 09:10 | - | |
| csstidy/ | 2024-06-08 08:14 | - | |
| cssparser/ | 2022-05-21 07:35 | - | |
| cssmin/ | 2023-01-30 01:49 | - | |
| cssc/ | 2020-12-30 07:34 | - | |
| css3pie/ | 2021-01-08 02:15 | - | |
| css2xslfo/ | 2023-07-16 07:29 | - | |
| css-mode/ | 2015-04-30 21:21 | - | |
| csoundqt/ | 2024-11-01 03:25 | - | |
| csound/ | 2024-08-23 21:01 | - | |
| csound-plugins/ | 2024-06-26 21:48 | - | |
| csound-manual/ | 2022-11-29 13:53 | - | |
| csmith/ | 2024-04-04 03:19 | - | |
| csmash/ | 2023-08-05 14:34 | - | |
| csmash-demosong/ | 2022-05-21 07:35 | - | |
| csladspa/ | 2024-04-19 06:27 | - | |
| csh/ | 2024-08-17 14:52 | - | |
| cscope/ | 2023-10-27 14:54 | - | |
| csaps/ | 2024-11-01 03:17 | - | |
| crystalspace/ | 2018-01-19 17:28 | - | |
| crystalhd/ | 2020-12-30 07:34 | - | |
| crystalcursors/ | 2021-01-03 07:42 | - | |
| crystal/ | 2024-05-18 08:33 | - | |
| crystal-facet-uml/ | 2024-06-11 20:51 | - | |
| cryptsetup/ | 2024-07-29 03:02 | - | |
| cryptsetup-nuke-password/ | 2024-05-09 14:45 | - | |
| cryptominisat/ | 2024-05-09 19:31 | - | |
| cryptokit/ | 2024-09-12 08:53 | - | |
| cryptojs/ | 2024-04-25 23:29 | - | |
| crypto-random-clojure/ | 2020-12-22 13:30 | - | |
| crypto-policies/ | 2019-10-26 11:43 | - | |
| crypto-equality-clojure/ | 2020-12-22 07:29 | - | |
| cryptmount/ | 2024-11-01 01:14 | - | |
| cryptkeeper/ | 2017-09-15 05:33 | - | |
| cryptgps/ | 2024-09-12 08:53 | - | |
| cryptcat/ | 2020-04-03 04:59 | - | |
| cryptacular/ | 2024-06-24 20:10 | - | |
| crypt++el/ | 2024-02-29 07:53 | - | |
| cryfs/ | 2024-11-01 06:03 | - | |
| crust-firmware/ | 2024-01-11 15:31 | - | |
| crunch/ | 2020-06-04 14:08 | - | |
| crun/ | 2024-11-01 03:26 | - | |
| cruft/ | 2024-01-11 03:14 | - | |
| cruft-ng/ | 2024-09-08 08:40 | - | |
| crudini/ | 2023-03-22 02:32 | - | |
| crtools/ | 2016-11-03 21:09 | - | |
| crtmpserver/ | 2021-11-23 23:57 | - | |
| crrcsim/ | 2024-04-09 09:38 | - | |
| crowdsec/ | 2024-08-31 20:45 | - | |
| crowdsec-firewall-bouncer/ | 2024-10-29 20:47 | - | |
| crowdsec-custom-bouncer/ | 2024-10-29 20:47 | - | |
| crowbar/ | 2024-09-12 08:53 | - | |
| crow-translate/ | 2024-07-16 14:44 | - | |
| crossroads/ | 2018-01-23 17:15 | - | |
| crosshurd/ | 2024-05-24 14:14 | - | |
| crossguid/ | 2024-04-22 23:50 | - | |
| crossfire/ | 2024-08-30 08:45 | - | |
| crossfire-maps/ | 2021-01-28 06:43 | - | |
| crossfire-maps-small/ | 2021-01-09 07:40 | - | |
| crossfire-client/ | 2024-05-09 19:31 | - | |
| crossfire-client-sounds/ | 2017-11-02 17:57 | - | |
| crossfire-client-images/ | 2020-07-27 01:24 | - | |
| crossbar/ | 2023-09-13 09:59 | - | |
| cross-toolchain-base/ | 2024-09-17 09:11 | - | |
| cross-toolchain-base-ports/ | 2024-09-27 18:11 | - | |
| cross-toolchain-base-mipsen/ | 2024-09-18 03:04 | - | |
| cross-gcc/ | 2024-02-20 07:22 | - | |
| cronutils/ | 2024-11-01 03:26 | - | |
| cronometer/ | 2022-07-24 11:42 | - | |
| cronolog/ | 2024-05-09 19:31 | - | |
| cronie/ | 2024-07-10 15:22 | - | |
| cronic/ | 2021-01-04 07:43 | - | |
| cron-deja-vu/ | 2020-03-31 20:20 | - | |
| cron-apt/ | 2022-04-30 13:32 | - | |
| crochet/ | 2020-04-16 01:08 | - | |
| croaring/ | 2024-04-05 09:26 | - | |
| crmsh/ | 2024-04-14 20:45 | - | |
| crm114/ | 2020-12-30 07:34 | - | |
| criu/ | 2024-03-27 02:44 | - | |
| critterding/ | 2024-11-01 03:26 | - | |
| critnib/ | 2024-04-22 23:50 | - | |
| criticalmass/ | 2024-04-04 03:19 | - | |
| criterion/ | 2024-04-24 02:54 | - | |
| critcl/ | 2020-06-23 02:15 | - | |
| crispy-doom/ | 2024-08-09 20:06 | - | |
| crip/ | 2024-06-12 01:54 | - | |
| crimson/ | 2024-11-01 03:26 | - | |
| cricket/ | 2024-05-09 19:31 | - | |
| creoleparser/ | 2020-07-14 22:44 | - | |
| creepy/ | 2018-01-22 16:52 | - | |
| creduce/ | 2024-09-10 22:43 | - | |
| credential-sheets/ | 2021-04-29 20:25 | - | |
| creddump7/ | 2022-06-15 08:20 | - | |
| credcheck/ | 2024-11-01 01:14 | - | |
| createrepo/ | 2015-04-30 21:21 | - | |
| createrepo-c/ | 2024-11-01 03:26 | - | |
| create-resources/ | 2020-04-09 15:33 | - | |
| cream/ | 2021-01-05 07:40 | - | |
| cream-melange/ | 2013-10-23 15:19 | - | |
| crdt-el/ | 2024-07-27 09:02 | - | |
| crccheck/ | 2024-01-11 09:10 | - | |
| crazywa/ | 2020-04-03 04:59 | - | |
| crazydiskinfo/ | 2020-07-26 08:14 | - | |
| crawl/ | 2022-12-07 22:14 | - | |
| crasm/ | 2020-12-30 07:34 | - | |
| crashtest/ | 2024-01-11 09:10 | - | |
| crashme/ | 2020-04-03 01:56 | - | |
| crashmail/ | 2024-01-11 09:10 | - | |
| cramfsswap/ | 2024-07-11 21:00 | - | |
| cramfs/ | 2016-04-11 14:25 | - | |
| cram/ | 2022-04-30 13:32 | - | |
| cracklib2/ | 2024-04-06 21:48 | - | |
| crack/ | 2024-09-19 02:56 | - | |
| crack-attack/ | 2024-04-06 21:48 | - | |
| crac/ | 2024-04-11 02:51 | - | |
| crac-criu/ | 2024-08-27 18:21 | - | |
| cqrlog/ | 2024-06-22 20:51 | - | |
| cqrlib/ | 2024-04-22 23:50 | - | |
| cputool/ | 2020-04-03 01:56 | - | |
| cpustat/ | 2024-07-18 10:18 | - | |
| cpuset/ | 2023-12-12 13:47 | - | |
| cpupower-gui/ | 2024-11-01 03:26 | - | |
| cpulimit/ | 2024-05-18 02:13 | - | |
| cpuinfo/ | 2024-10-02 06:49 | - | |
| cpuid/ | 2024-11-01 03:17 | - | |
| cpufrequtils/ | 2024-04-19 06:27 | - | |
| cpufreqd/ | 2024-01-13 03:11 | - | |
| cpufetch/ | 2024-11-01 03:23 | - | |
| cpuburn/ | 2016-11-01 09:18 | - | |
| cpu/ | 2024-11-01 03:26 | - | |
| cpu-x/ | 2024-06-14 19:29 | - | |
| cpu-features/ | 2023-11-07 13:46 | - | |
| cproto/ | 2024-07-14 08:51 | - | |
| cpqarrayd/ | 2020-02-17 04:53 | - | |
| cppzmq/ | 2024-04-22 20:45 | - | |
| cppy/ | 2024-05-03 10:40 | - | |
| cpputest/ | 2024-02-28 22:13 | - | |
| cppunit/ | 2024-04-22 18:51 | - | |
| cpptraj/ | 2024-08-07 03:13 | - | |
| cpptoml/ | 2022-11-06 11:23 | - | |
| cpptest/ | 2024-04-22 18:51 | - | |
| cpptasks/ | 2019-10-26 05:16 | - | |
| cpprest/ | 2024-04-06 21:48 | - | |
| cppreference-doc/ | 2020-01-20 14:13 | - | |
| cppo/ | 2024-11-01 03:26 | - | |
| cppnumericalsolvers/ | 2021-10-20 02:59 | - | |
| cppman/ | 2024-11-01 03:17 | - | |
| cpplint/ | 2023-12-24 19:47 | - | |
| cppimport/ | 2024-05-28 02:09 | - | |
| cppi/ | 2024-07-27 00:22 | - | |
| cpphs/ | 2024-10-22 21:18 | - | |
| cppgir/ | 2024-11-01 03:26 | - | |
| cppformat/ | 2020-07-11 05:52 | - | |
| cppdb/ | 2024-04-05 09:26 | - | |
| cppdap/ | 2024-11-01 03:26 | - | |
| cppcheck/ | 2024-11-01 03:26 | - | |
| cppad/ | 2024-11-01 05:31 | - | |
| cpp-netlib/ | 2018-06-22 23:13 | - | |
| cpp-jwt/ | 2024-04-11 01:38 | - | |
| cpp-httplib/ | 2024-11-01 01:14 | - | |
| cpp-hocon/ | 2024-04-06 21:48 | - | |
| cpopen/ | 2020-07-14 22:44 | - | |
| cpmtools/ | 2024-11-01 01:14 | - | |
| cpm/ | 2024-03-27 02:44 | - | |
| cpluff/ | 2024-04-05 03:15 | - | |
| cplay/ | 2020-12-30 07:34 | - | |
| cplay-ng/ | 2024-08-08 21:08 | - | |
| cpl/ | 2024-04-04 03:19 | - | |
| cpl-plugin-xshoo/ | 2024-10-01 08:40 | - | |
| cpl-plugin-xsh/ | 2014-01-14 14:23 | - | |
| cpl-plugin-visir/ | 2024-07-30 16:11 | - | |
| cpl-plugin-vimos/ | 2024-07-30 16:11 | - | |
| cpl-plugin-uves/ | 2024-07-30 15:00 | - | |
| cpl-plugin-sinfo/ | 2020-12-30 07:34 | - | |
| cpl-plugin-naco/ | 2024-07-30 16:11 | - | |
| cpl-plugin-muse/ | 2024-07-30 16:11 | - | |
| cpl-plugin-kmos/ | 2020-12-30 07:34 | - | |
| cpl-plugin-hawki/ | 2024-07-30 16:11 | - | |
| cpl-plugin-giraf/ | 2024-04-05 03:15 | - | |
| cpl-plugin-fors/ | 2024-10-01 08:40 | - | |
| cpl-plugin-amber/ | 2024-04-05 03:15 | - | |
| cpipe/ | 2022-11-24 13:49 | - | |
| cpio/ | 2024-04-30 20:47 | - | |
| cpdb-libs/ | 2024-08-13 01:34 | - | |
| cpdb-backend-gcp/ | 2020-12-30 07:34 | - | |
| cpdb-backend-file/ | 2024-04-03 03:03 | - | |
| cpdb-backend-cups/ | 2024-08-09 15:08 | - | |
| cpath-clojure/ | 2020-12-15 08:44 | - | |
| cpanoutdated/ | 2022-06-06 07:24 | - | |
| cpanminus/ | 2023-08-15 01:45 | - | |
| cpan-listchanges/ | 2022-12-10 07:44 | - | |
| cp2k/ | 2024-03-27 02:44 | - | |
| cozy/ | 2024-06-09 08:44 | - | |
| coz-profiler/ | 2024-05-10 02:40 | - | |
| coyote/ | 2022-04-30 13:32 | - | |
| coyim/ | 2023-02-16 18:43 | - | |
| cowsql/ | 2024-04-06 21:48 | - | |
| cowsay/ | 2020-12-30 07:34 | - | |
| cowpatty/ | 2024-04-05 15:45 | - | |
| cowdancer/ | 2024-06-02 14:03 | - | |
| cowbell/ | 2020-03-23 02:11 | - | |
| covtobed/ | 2023-10-30 14:21 | - | |
| covered/ | 2023-05-02 13:14 | - | |
| cov-core/ | 2022-04-30 13:32 | - | |
| courierpassd/ | 2018-01-22 16:52 | - | |
| couriergrey/ | 2024-04-14 20:45 | - | |
| couriergraph/ | 2023-08-08 14:04 | - | |
| courier/ | 2024-04-14 20:45 | - | |
| courier-unicode/ | 2024-04-22 23:50 | - | |
| courier-filter-perl/ | 2024-01-11 09:10 | - | |
| courier-authlib/ | 2024-04-04 03:19 | - | |
| couchdb/ | 2020-07-11 05:52 | - | |
| couchapp/ | 2018-01-22 16:52 | - | |
| coturn/ | 2024-05-09 19:31 | - | |
| cothreads/ | 2024-08-11 02:50 | - | |
| cortina/ | 2020-07-13 16:51 | - | |
| cortado/ | 2021-10-19 19:55 | - | |
| corrosion/ | 2024-07-03 15:57 | - | |
| corosync/ | 2024-06-30 21:04 | - | |
| corosync-qdevice/ | 2024-07-15 14:31 | - | |
| corkscrew/ | 2024-07-15 14:31 | - | |
| coriander/ | 2020-07-11 05:52 | - | |
| coreutils/ | 2020-07-11 14:17 | - | |
| coreschema/ | 2022-05-28 20:18 | - | |
| coremltools/ | 2024-11-01 01:14 | - | |
| corekeeper/ | 2020-12-30 07:34 | - | |
| corectrl/ | 2024-09-25 15:02 | - | |
| coreboot/ | 2024-01-12 03:18 | - | |
| corebird/ | 2020-07-11 05:52 | - | |
| coreapi/ | 2022-05-28 02:19 | - | |
| core-specs-alpha-clojure/ | 2024-01-11 03:14 | - | |
| core-network/ | 2018-06-22 23:13 | - | |
| core-memoize-clojure/ | 2022-11-06 11:23 | - | |
| core-match-clojure/ | 2020-12-02 07:39 | - | |
| core-cache-clojure/ | 2022-11-06 11:23 | - | |
| core-async-clojure/ | 2024-01-11 09:10 | - | |
| cordova-ubuntu/ | 2018-01-22 16:52 | - | |
| cordova-ubuntu-tests/ | 2015-04-29 02:04 | - | |
| cordova-ubuntu-3.4/ | 2014-06-23 19:36 | - | |
| coquelicot/ | 2024-09-22 08:44 | - | |
| coqprime/ | 2024-09-12 08:53 | - | |
| coqeal/ | 2024-09-22 08:44 | - | |
| coq/ | 2024-09-12 08:53 | - | |
| coq-unimath/ | 2024-09-12 08:53 | - | |
| coq-unicoq/ | 2024-09-12 08:53 | - | |
| coq-stdpp/ | 2024-09-12 08:53 | - | |
| coq-simple-io/ | 2024-09-12 08:53 | - | |
| coq-serapi/ | 2024-09-12 08:53 | - | |
| coq-relation-algebra/ | 2024-09-22 08:44 | - | |
| coq-reglang/ | 2024-09-22 08:44 | - | |
| coq-reduction-effects/ | 2024-09-12 08:53 | - | |
| coq-record-update/ | 2024-09-12 08:53 | - | |
| coq-quickchick/ | 2024-09-22 08:44 | - | |
| coq-mtac2/ | 2024-09-12 08:53 | - | |
| coq-menhirlib/ | 2024-09-12 08:53 | - | |
| coq-math-classes/ | 2024-09-12 08:53 | - | |
| coq-libhyps/ | 2024-09-12 08:53 | - | |
| coq-iris/ | 2024-09-12 08:53 | - | |
| coq-interval/ | 2024-09-22 08:44 | - | |
| coq-hott/ | 2024-09-12 08:53 | - | |
| coq-highschoolgeometry/ | 2015-08-12 03:59 | - | |
| coq-hierarchy-builder/ | 2024-09-22 08:44 | - | |
| coq-hammer/ | 2024-09-12 08:53 | - | |
| coq-gappa/ | 2024-09-12 08:53 | - | |
| coq-float/ | 2020-09-30 08:14 | - | |
| coq-extructures/ | 2024-09-22 08:44 | - | |
| coq-ext-lib/ | 2024-09-12 08:53 | - | |
| coq-equations/ | 2024-09-12 08:53 | - | |
| coq-elpi/ | 2024-09-22 08:44 | - | |
| coq-dpdgraph/ | 2024-09-12 08:53 | - | |
| coq-deriving/ | 2024-09-22 08:44 | - | |
| coq-corn/ | 2024-09-12 08:53 | - | |
| coq-bignums/ | 2024-09-12 08:53 | - | |
| copyright-update/ | 2024-06-13 20:08 | - | |
| copyq/ | 2024-11-01 03:26 | - | |
| copyfs/ | 2020-01-25 08:21 | - | |
| copy-rename-maven-plugin/ | 2024-01-13 15:21 | - | |
| coot/ | 2024-09-12 08:53 | - | |
| coolmail/ | 2024-04-10 02:53 | - | |
| coolkey/ | 2024-04-04 03:19 | - | |
| cool-retro-term/ | 2024-11-01 03:26 | - | |
| cookietool/ | 2024-05-09 19:31 | - | |
| cookiecutter/ | 2024-02-29 01:49 | - | |
| cook/ | 2016-11-01 09:18 | - | |
| convoy/ | 2020-04-20 14:14 | - | |
| convmv/ | 2021-01-02 07:42 | - | |
| convlit/ | 2024-05-09 19:31 | - | |
| convertdate/ | 2023-01-27 14:35 | - | |
| convertall/ | 2022-12-27 13:44 | - | |
| converseen/ | 2024-05-09 19:31 | - | |
| conversant-disruptor/ | 2020-07-11 05:52 | - | |
| conv-tools/ | 2024-05-09 19:31 | - | |
| controlsfx/ | 2022-05-25 07:24 | - | |
| controlaula/ | 2016-11-01 21:25 | - | |
| controku/ | 2024-11-01 03:17 | - | |
| contourpy/ | 2024-11-01 03:26 | - | |
| continuity/ | 2022-08-22 14:36 | - | |
| contextlib2/ | 2024-03-01 07:34 | - | |
| contextfree/ | 2024-08-13 21:02 | - | |
| context/ | 2024-06-06 01:57 | - | |
| context-modules/ | 2024-06-06 01:57 | - | |
| content-hub/ | 2024-05-15 03:11 | - | |
| containerd/ | 2024-10-25 21:00 | - | |
| containerd-app/ | 2024-06-11 20:51 | - | |
| contactsd/ | 2024-07-16 21:17 | - | |
| consult-el/ | 2024-11-01 03:17 | - | |
| consulfs/ | 2021-12-23 10:58 | - | |
| consul/ | 2024-01-18 17:56 | - | |
| consul-migrate/ | 2015-11-14 01:51 | - | |
| construct/ | 2024-01-11 03:14 | - | |
| construct.legacy/ | 2019-10-26 05:16 | - | |
| constantly/ | 2019-12-17 21:05 | - | |
| conspy/ | 2020-12-30 07:34 | - | |
| consonance/ | 2022-07-24 11:42 | - | |
| consolekit2/ | 2024-06-19 10:11 | - | |
| consolekit/ | 2020-07-11 05:52 | - | |
| console-setup/ | 2024-07-04 01:20 | - | |
| console-log/ | 2021-01-05 07:40 | - | |
| console-data/ | 2021-10-27 07:28 | - | |
| console-cyrillic/ | 2023-10-27 03:36 | - | |
| console-common/ | 2020-12-30 07:34 | - | |
| console-bridge/ | 2024-04-22 23:50 | - | |
| console-braille/ | 2022-07-24 11:42 | - | |
| consolation/ | 2024-07-06 03:16 | - | |
| consfigurator/ | 2024-11-01 03:17 | - | |
| conserver/ | 2024-11-01 03:26 | - | |
| conservation-code/ | 2020-12-30 07:34 | - | |
| consensuscore/ | 2024-05-06 20:44 | - | |
| cons/ | 2016-07-21 14:19 | - | |
| conquest-dicom-server/ | 2018-01-22 16:52 | - | |
| conque/ | 2011-11-12 20:14 | - | |
| conntrack/ | 2018-01-23 02:17 | - | |
| conntrack-tools/ | 2024-05-09 13:09 | - | |
| connman/ | 2024-11-01 03:26 | - | |
| connman-ui/ | 2024-04-11 08:50 | - | |
| connman-gtk/ | 2024-08-24 14:35 | - | |
| connectomeviewer/ | 2020-07-14 22:44 | - | |
| connectome-workbench/ | 2024-11-01 03:26 | - | |
| connectivity-api/ | 2018-01-22 16:52 | - | |
| connectagram/ | 2024-06-01 16:35 | - | |
| connect-proxy/ | 2023-07-28 08:01 | - | |
| conmux/ | 2024-01-11 09:10 | - | |
| conmon/ | 2024-11-01 03:26 | - | |
| conman/ | 2024-02-26 13:37 | - | |
| conky/ | 2024-08-16 03:02 | - | |
| conky-all/ | 2015-04-29 02:04 | - | |
| conjure/ | 2016-04-16 08:49 | - | |
| conjure-up/ | 2018-06-22 23:13 | - | |
| congruity/ | 2022-08-17 13:39 | - | |
| congress/ | 2022-07-23 16:03 | - | |
| confy/ | 2024-05-03 10:41 | - | |
| confuse/ | 2021-12-23 10:58 | - | |
| confusable-homoglyphs/ | 2024-02-03 02:57 | - | |
| confluence/ | 2016-11-01 16:16 | - | |
| configure-debian/ | 2022-11-24 13:29 | - | |
| configshell/ | 2018-01-19 17:28 | - | |
| configparser/ | 2021-12-23 10:58 | - | |
| config-package-dev/ | 2020-07-11 05:52 | - | |
| config-manager/ | 2018-01-22 16:52 | - | |
| confget/ | 2024-06-07 01:43 | - | |
| confetti/ | 2015-12-05 03:13 | - | |
| confclerk/ | 2024-05-09 19:31 | - | |
| confargparse/ | 2015-12-04 13:35 | - | |
| cone/ | 2016-11-01 16:16 | - | |
| conduit/ | 2015-04-30 21:21 | - | |
| condor/ | 2024-09-07 02:54 | - | |
| conda-package-streaming/ | 2024-06-26 08:51 | - | |
| conda-package-handling/ | 2024-06-26 08:52 | - | |
| concurrentqueue/ | 2023-07-13 08:17 | - | |
| concurrent-log-handler/ | 2023-12-31 07:46 | - | |
| concurrent-dfsg/ | 2023-02-18 20:33 | - | |
| concordance/ | 2024-05-27 14:15 | - | |
| concavity/ | 2020-12-30 07:34 | - | |
| concalc/ | 2022-12-23 09:29 | - | |
| comskip/ | 2024-10-08 20:53 | - | |
| compyle/ | 2024-11-01 03:17 | - | |
| compute/ | 2018-01-22 16:52 | - | |
| comptty/ | 2024-04-04 03:19 | - | |
| compton/ | 2024-01-26 14:10 | - | |
| compton-conf/ | 2024-04-06 21:48 | - | |
| comptext/ | 2024-04-04 03:19 | - | |
| comprez/ | 2020-10-29 04:35 | - | |
| compress-lzf/ | 2019-01-29 13:18 | - | |
| compreffor/ | 2024-11-01 01:14 | - | |
| composite/ | 2018-06-22 23:13 | - | |
| composer/ | 2024-11-01 03:17 | - | |
| compojure-clojure/ | 2021-01-07 07:45 | - | |
| complexity/ | 2021-10-21 05:56 | - | |
| complete-clojure/ | 2020-07-11 05:52 | - | |
| compizconfig-backend-kconfig/ | 2016-11-01 09:18 | - | |
| compiz/ | 2024-04-07 20:50 | - | |
| compiz-fusion-bcop/ | 2015-04-30 21:21 | - | |
| compiz-boxmenu/ | 2024-04-06 21:48 | - | |
| compiz-bcop/ | 2022-11-06 11:23 | - | |
| compile-command-annotations/ | 2019-10-26 11:43 | - | |
| compat-el/ | 2024-07-27 09:02 | - | |
| compass-yui-plugin/ | 2017-01-24 07:25 | - | |
| compass-toolkit-plugin/ | 2022-07-24 11:42 | - | |
| compass-susy-plugin/ | 2020-02-12 13:18 | - | |
| compass-slickmap-plugin/ | 2018-06-22 23:13 | - | |
| compass-singularitygs-plugin/ | 2018-06-22 23:13 | - | |
| compass-sassy-maps-plugin/ | 2022-07-24 11:42 | - | |
| compass-normalize-plugin/ | 2021-04-29 21:06 | - | |
| compass-layoutgala-plugin/ | 2021-04-29 21:06 | - | |
| compass-h5bp-plugin/ | 2021-04-29 21:06 | - | |
| compass-fancy-buttons-plugin/ | 2022-07-24 11:42 | - | |
| compass-color-schemer-plugin/ | 2021-04-29 21:06 | - | |
| compass-breakpoint-plugin/ | 2022-08-26 07:54 | - | |
| compass-blueprint-plugin/ | 2024-03-23 01:13 | - | |
| compass-blend-modes-plugin/ | 2024-03-23 01:13 | - | |
| compartment/ | 2024-04-06 21:48 | - | |
| comparepdf/ | 2024-04-06 21:48 | - | |
| comparelib/ | 2020-07-11 05:52 | - | |
| company-mode/ | 2024-11-01 03:17 | - | |
| company-lsp/ | 2020-12-26 13:29 | - | |
| community-themes/ | 2020-04-01 14:19 | - | |
| commons-vfs/ | 2023-01-04 20:34 | - | |
| commons-text/ | 2024-11-01 03:17 | - | |
| commons-pool2/ | 2024-07-29 02:05 | - | |
| commons-pool/ | 2024-01-09 19:21 | - | |
| commons-parent/ | 2023-01-09 08:32 | - | |
| commons-math3/ | 2020-07-11 05:52 | - | |
| commons-math/ | 2024-11-01 03:17 | - | |
| commons-jcs/ | 2015-11-20 20:16 | - | |
| commons-jci/ | 2024-11-01 03:17 | - | |
| commons-javaflow/ | 2020-07-11 05:52 | - | |
| commons-io/ | 2024-11-01 03:17 | - | |
| commons-httpclient/ | 2021-02-08 13:34 | - | |
| commons-exec/ | 2021-02-05 20:18 | - | |
| commons-email/ | 2020-07-13 16:51 | - | |
| commons-dbcp2/ | 2024-11-01 03:17 | - | |
| commons-daemon/ | 2024-04-24 02:54 | - | |
| commons-csv/ | 2022-07-24 11:42 | - | |
| commons-configuration2/ | 2024-11-01 03:17 | - | |
| commons-configuration/ | 2024-11-01 03:17 | - | |
| commons-beanutils/ | 2024-01-04 02:29 | - | |
| commonmark/ | 2024-05-03 10:41 | - | |
| commonmark-bkrs/ | 2024-02-08 13:44 | - | |
| common-lisp-controller/ | 2020-12-30 07:34 | - | |
| commit-patch/ | 2024-11-01 03:17 | - | |
| commando/ | 2022-05-23 13:24 | - | |
| command-runner-applet/ | 2018-01-19 17:28 | - | |
| command-not-found/ | 2020-07-11 05:51 | - | |
| comixcursors/ | 2022-05-11 19:54 | - | |
| comix/ | 2020-12-30 07:34 | - | |
| comitup/ | 2024-11-01 03:17 | - | |
| comidi-clojure/ | 2020-12-21 14:14 | - | |
| comic-neue/ | 2023-01-29 01:29 | - | |
| comgt/ | 2024-05-14 08:47 | - | |
| comet-ms/ | 2024-04-17 02:55 | - | |
| comedilib/ | 2024-08-17 13:25 | - | |
| combblas/ | 2024-11-01 04:58 | - | |
| combat/ | 2022-11-14 07:24 | - | |
| com-hypirion-io-clojure/ | 2024-11-01 03:17 | - | |
| colrconv/ | 2016-11-01 16:16 | - | |
| colplot/ | 2023-11-08 01:36 | - | |
| colpack/ | 2024-05-09 19:31 | - | |
| colorzero/ | 2022-07-24 11:42 | - | |
| colorthief/ | 2024-08-01 21:14 | - | |
| colortest/ | 2022-07-24 11:42 | - | |
| colortest-python/ | 2022-11-22 07:50 | - | |
| colortail/ | 2020-04-03 04:59 | - | |
| colorspacious/ | 2024-03-30 15:16 | - | |
| colors.js/ | 2022-11-06 11:23 | - | |
| colorpicker/ | 2017-11-02 08:27 | - | |
| colorname/ | 2016-11-01 16:16 | - | |
| colormake/ | 2020-10-29 04:35 | - | |
| colorized-logs/ | 2021-10-21 05:20 | - | |
| colorize/ | 2024-07-14 20:49 | - | |
| colorhug-client/ | 2024-04-06 21:48 | - | |
| colorgcc/ | 2017-07-29 08:17 | - | |
| colorediffs-extension/ | 2014-06-27 02:16 | - | |
| colored/ | 2024-11-01 03:17 | - | |
| colordiff/ | 2024-06-12 13:59 | - | |
| colord/ | 2024-08-13 01:34 | - | |
| colord-kde/ | 2024-09-22 17:19 | - | |
| colord-gtk/ | 2024-04-04 03:19 | - | |
| colorcode/ | 2024-04-06 21:48 | - | |
| colorclass/ | 2024-07-25 19:48 | - | |
| colorchooser/ | 2011-05-05 19:07 | - | |
| colorcet/ | 2024-11-01 03:17 | - | |
| colorblind/ | 2016-11-01 09:14 | - | |
| color-theme-modern/ | 2024-07-27 09:02 | - | |
| color-picker/ | 2024-05-14 03:24 | - | |
| colobot/ | 2024-05-09 19:31 | - | |
| colmap/ | 2024-07-26 21:19 | - | |
| collectl/ | 2020-07-14 22:44 | - | |
| collectl-utils/ | 2018-01-19 17:28 | - | |
| collections15/ | 2012-01-09 09:34 | - | |
| collectd/ | 2024-10-26 20:43 | - | |
| collatinus/ | 2024-05-11 07:04 | - | |
| collada2gltf/ | 2022-11-06 16:01 | - | |
| collada-dom/ | 2024-04-06 21:48 | - | |
| collabtive/ | 2020-10-20 00:33 | - | |
| collab-qa-tools/ | 2014-10-26 09:27 | - | |
| colibri/ | 2016-11-01 21:25 | - | |
| coldfire/ | 2016-11-01 09:18 | - | |
| coinutils/ | 2024-11-01 03:26 | - | |
| coinst/ | 2024-08-06 20:31 | - | |
| coinor-vol/ | 2020-04-04 19:58 | - | |
| coinor-symphony/ | 2022-07-24 11:42 | - | |
| coinor-osi/ | 2024-05-09 19:31 | - | |
| coinor-ipopt/ | 2024-04-05 15:45 | - | |
| coinor-flopc++/ | 2020-06-19 02:15 | - | |
| coinor-dylp/ | 2024-04-23 00:59 | - | |
| coinor-csdp/ | 2024-04-23 00:59 | - | |
| coinor-cgl/ | 2024-11-01 03:26 | - | |
| coinor-cbc/ | 2024-11-01 03:26 | - | |
| coinor-bonmin/ | 2024-04-05 09:26 | - | |
| coinmp/ | 2024-04-22 23:50 | - | |
| coin3/ | 2024-05-14 04:58 | - | |
| coils/ | 2022-07-24 11:42 | - | |
| cohomcalg/ | 2024-04-11 08:50 | - | |
| coherence/ | 2016-11-01 16:04 | - | |
| cognitive-complexity/ | 2022-07-21 14:20 | - | |
| cogl/ | 2024-04-05 21:13 | - | |
| cog/ | 2023-02-11 02:32 | - | |
| cofoja/ | 2022-12-14 07:35 | - | |
| coffeescript/ | 2024-05-27 01:38 | - | |
| codraft/ | 2024-01-12 16:14 | - | |
| codonw/ | 2024-04-08 18:16 | - | |
| codicefiscale/ | 2022-04-30 13:32 | - | |
| codfis/ | 2024-11-01 03:26 | - | |
| codeville/ | 2020-03-28 02:33 | - | |
| codetools/ | 2024-05-03 10:41 | - | |
| codetiming/ | 2024-02-18 15:58 | - | |
| codespell/ | 2024-11-01 03:17 | - | |
| codesearch/ | 2024-11-01 03:26 | - | |
| coderay/ | 2022-07-24 11:42 | - | |
| codequery/ | 2024-04-06 21:48 | - | |
| codenarc/ | 2020-07-11 05:52 | - | |
| codemirror-js/ | 2023-08-15 05:04 | - | |
| codelite/ | 2024-09-09 08:44 | - | |
| codegroup/ | 2024-05-09 19:31 | - | |
| codecrypt/ | 2024-04-09 08:53 | - | |
| codecgraph/ | 2022-07-24 11:42 | - | |
| codec2/ | 2024-04-19 06:28 | - | |
| codeblocks/ | 2024-11-01 08:56 | - | |
| code2html/ | 2023-10-27 03:37 | - | |
| code-saturne/ | 2024-04-09 02:55 | - | |
| code-of-conduct-signing-assistant/ | 2017-07-29 04:48 | - | |
| coda/ | 2024-07-31 09:03 | - | |
| cod-tools/ | 2024-10-26 20:43 | - | |
| coco-java/ | 2024-06-06 07:43 | - | |
| coco-doc/ | 2019-12-22 19:13 | - | |
| coco-cs/ | 2023-08-07 01:29 | - | |
| coco-cpp/ | 2023-08-07 07:44 | - | |
| cockpit/ | 2024-11-01 03:26 | - | |
| cockpit-podman/ | 2024-11-01 03:17 | - | |
| cockpit-machines/ | 2024-11-01 03:17 | - | |
| coccinelle/ | 2024-09-12 08:53 | - | |
| coccinella/ | 2018-11-09 16:44 | - | |
| cobra-cli/ | 2024-10-29 20:47 | - | |
| cobertura/ | 2018-07-16 07:18 | - | |
| cobertura-maven-plugin/ | 2015-07-17 01:24 | - | |
| cobbler/ | 2020-07-11 05:52 | - | |
| cobbler-enlist/ | 2015-12-05 03:12 | - | |
| cobalt-panel-utils/ | 2006-11-21 21:04 | - | |
| coala/ | 2015-12-05 03:13 | - | |
| cnvkit/ | 2024-05-03 10:41 | - | |
| cntlm/ | 2024-04-04 03:19 | - | |
| cnrun/ | 2016-10-01 08:26 | - | |
| cnf/ | 2016-10-31 20:45 | - | |
| cmyt/ | 2024-01-11 15:31 | - | |
| cmus/ | 2024-08-13 21:02 | - | |
| cmtk/ | 2024-07-08 17:27 | - | |
| cmt/ | 2024-04-19 06:28 | - | |
| cmst/ | 2024-04-06 21:48 | - | |
| cmph/ | 2024-04-06 21:48 | - | |
| cmospwd/ | 2023-10-27 03:38 | - | |
| cmor/ | 2024-11-01 03:26 | - | |
| cmor-tables/ | 2021-01-06 01:40 | - | |
| cmocka/ | 2024-01-14 09:04 | - | |
| cmocka-mocks/ | 2024-09-13 13:56 | - | |
| cmocka-extensions/ | 2024-07-04 18:36 | - | |
| cmock/ | 2024-02-17 14:54 | - | |
| cmlxom/ | 2024-05-18 01:29 | - | |
| cmip5-cmor-tables/ | 2015-10-24 08:51 | - | |
| cminpack/ | 2024-04-22 23:50 | - | |
| cmigrep/ | 2018-06-22 23:13 | - | |
| cmigemo/ | 2024-04-24 02:54 | - | |
| cme/ | 2024-01-25 15:01 | - | |
| cmdtest/ | 2024-11-01 03:17 | - | |
| cmdreader/ | 2022-02-17 14:10 | - | |
| cmdpack/ | 2018-04-04 04:17 | - | |
| cmdliner/ | 2024-09-12 08:53 | - | |
| cmatrix/ | 2023-10-27 09:02 | - | |
| cmark/ | 2024-04-19 07:31 | - | |
| cmark-gfm/ | 2024-04-22 19:49 | - | |
| cmake3/ | 2017-06-15 02:30 | - | |
| cmake/ | 2024-11-01 05:32 | - | |
| cmake-vala/ | 2020-07-14 22:44 | - | |
| cmake-mozilla/ | 2024-02-26 11:19 | - | |
| cmake-format/ | 2024-11-01 03:17 | - | |
| cmake-fedora/ | 2021-11-22 14:09 | - | |
| cmake-extras/ | 2024-07-08 20:47 | - | |
| cm-super/ | 2021-11-06 19:54 | - | |
| clzip/ | 2024-07-25 19:48 | - | |
| clxclient/ | 2024-04-06 21:48 | - | |
| clutter-sharp/ | 2015-04-26 20:12 | - | |
| clutter-imcontext/ | 2024-04-11 08:50 | - | |
| clutter-gtk/ | 2024-04-07 02:46 | - | |
| clutter-gst/ | 2018-01-19 17:28 | - | |
| clutter-gst-3.0/ | 2024-04-07 02:46 | - | |
| clutter-gst-2.0/ | 2016-04-08 06:49 | - | |
| clutter-gesture/ | 2018-01-23 17:04 | - | |
| clutter-1.0/ | 2024-04-07 08:45 | - | |
| clusterssh/ | 2024-11-01 03:17 | - | |
| clustershell/ | 2024-01-11 09:10 | - | |
| cluster/ | 2024-04-24 02:54 | - | |
| cluster-glue/ | 2024-07-12 07:37 | - | |
| cluster-agents/ | 2016-11-02 20:52 | - | |
| clustalw/ | 2020-12-30 07:34 | - | |
| clustalo/ | 2024-04-24 02:54 | - | |
| clues-emacs/ | 2022-07-24 11:42 | - | |
| clucy/ | 2020-07-11 05:52 | - | |
| clthreads/ | 2024-04-04 21:29 | - | |
| clsync/ | 2024-04-06 21:48 | - | |
| clsparse/ | 2017-04-06 14:44 | - | |
| clpeak/ | 2024-11-01 03:26 | - | |
| clp/ | 2024-11-01 03:26 | - | |
| clout-clojure/ | 2021-01-07 07:45 | - | |
| cloudsql-proxy/ | 2024-10-29 20:47 | - | |
| cloudprint/ | 2022-07-23 16:03 | - | |
| cloudpickle/ | 2024-04-09 02:55 | - | |
| cloudkitty/ | 2024-10-04 21:06 | - | |
| cloudkitty-tempest-plugin/ | 2024-11-01 03:17 | - | |
| cloudkitty-dashboard/ | 2024-10-04 21:06 | - | |
| cloudfusion/ | 2010-02-23 01:06 | - | |
| cloudflare-ddns/ | 2024-08-11 02:50 | - | |
| cloudcompare/ | 2024-11-01 03:26 | - | |
| cloud-utils/ | 2020-12-30 07:34 | - | |
| cloud-sptheme/ | 2023-04-03 08:31 | - | |
| cloud-installer/ | 2018-01-22 16:52 | - | |
| cloud-initramfs-tools/ | 2024-07-31 14:29 | - | |
| cloud-init/ | 2021-04-29 08:15 | - | |
| cloud-enum/ | 2024-01-11 03:14 | - | |
| closure-linter/ | 2020-03-02 08:16 | - | |
| closure-compiler/ | 2023-12-20 19:52 | - | |
| closql-el/ | 2024-11-01 03:17 | - | |
| cloop/ | 2022-12-23 15:34 | - | |
| cloog/ | 2018-03-16 20:15 | - | |
| cloog-ppl/ | 2018-06-22 23:13 | - | |
| cloog-ppl-gcc4/ | 2016-04-18 08:22 | - | |
| clonezilla/ | 2024-11-01 03:17 | - | |
| clonalorigin/ | 2024-07-30 16:11 | - | |
| clonalframeml/ | 2024-02-02 04:00 | - | |
| clonalframe/ | 2024-07-30 15:02 | - | |
| clojure1.8/ | 2020-07-14 22:44 | - | |
| clojure1.6/ | 2018-01-23 17:16 | - | |
| clojure1.4/ | 2015-04-28 00:01 | - | |
| clojure1.2/ | 2018-01-22 16:52 | - | |
| clojure/ | 2024-06-03 19:49 | - | |
| clojure-mode/ | 2024-08-01 21:14 | - | |
| clojure-maven-plugin/ | 2020-07-11 05:52 | - | |
| clojure-contrib/ | 2015-04-26 20:12 | - | |
| clog/ | 2024-01-07 02:10 | - | |
| clod/ | 2016-11-03 06:21 | - | |
| cloc/ | 2024-11-01 03:17 | - | |
| cln/ | 2024-01-23 06:06 | - | |
| cljx-clojure/ | 2020-12-19 14:16 | - | |
| clj-yaml-clojure/ | 2024-09-17 11:25 | - | |
| clj-tuple-clojure/ | 2021-01-07 07:45 | - | |
| clj-time-clojure/ | 2022-06-21 21:04 | - | |
| clj-stacktrace-clojure/ | 2020-11-24 07:34 | - | |
| clj-http-clojure/ | 2024-05-03 10:41 | - | |
| clj-digest-clojure/ | 2020-12-11 13:34 | - | |
| clive/ | 2016-11-01 21:26 | - | |
| clitest/ | 2022-07-23 16:03 | - | |
| clisp/ | 2024-04-06 21:48 | - | |
| clirr/ | 2018-03-26 20:15 | - | |
| clirr-maven-plugin/ | 2016-11-01 16:14 | - | |
| cliquer/ | 2024-04-22 23:50 | - | |
| clips/ | 2024-04-22 23:50 | - | |
| clips-doc/ | 2020-07-11 05:52 | - | |
| clippoly/ | 2024-05-10 00:00 | - | |
| clipper/ | 2024-04-22 18:51 | - | |
| clipman/ | 2024-10-29 20:47 | - | |
| clipit/ | 2024-09-10 20:13 | - | |
| cliphist/ | 2024-10-29 20:47 | - | |
| clipf/ | 2020-07-11 05:52 | - | |
| cliofetion/ | 2015-12-05 12:49 | - | |
| clinica/ | 2014-02-18 23:57 | - | |
| clinfo/ | 2024-04-19 07:31 | - | |
| clikit/ | 2024-11-01 03:17 | - | |
| cligh/ | 2020-07-11 05:52 | - | |
| cliff-tablib/ | 2016-02-19 16:19 | - | |
| clif/ | 2022-08-02 20:37 | - | |
| clickmanager-plugin/ | 2015-04-29 02:04 | - | |
| clickhouse/ | 2024-08-01 10:25 | - | |
| click/ | 2024-04-24 20:57 | - | |
| click-update-manager/ | 2015-04-29 02:04 | - | |
| click-ubuntu-policy/ | 2020-07-11 05:52 | - | |
| click-systemd/ | 2016-11-04 03:03 | - | |
| click-reviewers-tools/ | 2018-06-22 23:13 | - | |
| click-man/ | 2024-11-01 03:17 | - | |
| click-help-colors/ | 2024-01-11 09:10 | - | |
| click-completion/ | 2024-01-11 09:10 | - | |
| click-bin-path/ | 2018-01-19 17:28 | - | |
| cli11/ | 2024-02-29 14:51 | - | |
| cli-helpers/ | 2024-07-25 19:48 | - | |
| cli-common/ | 2024-05-03 10:41 | - | |
| clhep/ | 2024-04-04 03:19 | - | |
| clfswm/ | 2018-05-05 05:11 | - | |
| clfft/ | 2024-01-13 09:09 | - | |
| clex/ | 2020-12-30 07:34 | - | |
| clevis/ | 2024-04-13 02:46 | - | |
| cleo/ | 2022-11-06 11:23 | - | |
| clementine/ | 2024-04-08 08:48 | - | |
| clearsilver/ | 2024-10-20 17:09 | - | |
| clearlooks-phenix-theme/ | 2024-03-25 08:41 | - | |
| clearcut/ | 2022-07-24 11:42 | - | |
| clear-sans/ | 2019-10-26 11:43 | - | |
| clean-crypto/ | 2016-07-26 20:21 | - | |
| cldump/ | 2024-06-04 02:48 | - | |
| cld2/ | 2024-04-22 23:50 | - | |
| clc-intercal/ | 2024-10-21 15:22 | - | |
| clblast/ | 2024-06-16 00:49 | - | |
| clblas/ | 2024-09-05 15:02 | - | |
| clazy/ | 2024-07-23 03:13 | - | |
| clawsker/ | 2024-11-01 03:17 | - | |
| claws-mail/ | 2024-10-21 01:44 | - | |
| claws-mail-themes/ | 2022-11-06 11:24 | - | |
| classycle/ | 2020-12-29 19:30 | - | |
| classworlds/ | 2020-07-11 05:52 | - | |
| classmate/ | 2024-02-15 21:35 | - | |
| classmate-tools/ | 2015-04-30 21:21 | - | |
| classmate-artwork/ | 2008-03-15 10:12 | - | |
| classified-ads/ | 2024-07-27 09:02 | - | |
| classicmenu-indicator/ | 2019-11-27 20:43 | - | |
| classic-theme-restorer/ | 2018-01-23 17:16 | - | |
| class.js/ | 2021-01-09 07:40 | - | |
| clasp/ | 2023-05-03 08:26 | - | |
| clapper/ | 2024-07-25 09:01 | - | |
| clap/ | 2022-08-09 07:39 | - | |
| clanlib/ | 2024-04-15 20:45 | - | |
| clamz/ | 2024-04-11 08:50 | - | |
| clamtk/ | 2024-07-04 11:24 | - | |
| clamsmtp/ | 2024-07-04 14:20 | - | |
| clamfs/ | 2024-05-22 14:55 | - | |
| clamav/ | 2024-09-18 08:56 | - | |
| clamav-unofficial-sigs/ | 2021-01-02 13:31 | - | |
| clamav-cvdupdate/ | 2022-11-06 11:23 | - | |
| clamassassin/ | 2024-07-05 15:07 | - | |
| clam/ | 2018-01-19 17:28 | - | |
| clam-networkeditor/ | 2015-12-05 11:31 | - | |
| clam-chordata/ | 2011-05-19 06:04 | - | |
| clalsadrv/ | 2024-04-15 08:45 | - | |
| cl-zs3/ | 2021-01-07 07:45 | - | |
| cl-zip/ | 2021-01-08 07:53 | - | |
| cl-yason/ | 2021-01-06 07:55 | - | |
| cl-xptest/ | 2022-11-06 11:23 | - | |
| cl-xmls/ | 2020-07-13 16:51 | - | |
| cl-xlunit/ | 2022-11-06 11:23 | - | |
| cl-who/ | 2021-01-08 02:15 | - | |
| cl-uuid/ | 2021-01-06 01:40 | - | |
| cl-utilities/ | 2021-01-06 01:40 | - | |
| cl-usocket/ | 2024-11-01 03:17 | - | |
| cl-unicode/ | 2020-12-30 07:34 | - | |
| cl-uffi/ | 2021-02-07 22:28 | - | |
| cl-uax-15/ | 2021-12-27 08:18 | - | |
| cl-trivial-utf-8/ | 2021-01-06 01:40 | - | |
| cl-trivial-garbage/ | 2022-04-30 10:25 | - | |
| cl-trivial-backtrace/ | 2020-12-08 01:25 | - | |
| cl-sqlite/ | 2021-01-06 01:40 | - | |
| cl-sql/ | 2023-01-15 20:33 | - | |
| cl-split-sequence/ | 2022-07-24 11:42 | - | |
| cl-spatial-trees/ | 2016-10-31 20:46 | - | |
| cl-salza2/ | 2021-01-08 02:15 | - | |
| cl-salza/ | 2015-04-30 21:21 | - | |
| cl-rt/ | 2018-05-05 05:11 | - | |
| cl-rss/ | 2020-10-29 13:05 | - | |
| cl-rsm-mod/ | 2020-07-11 05:52 | - | |
| cl-rlc/ | 2015-04-30 21:21 | - | |
| cl-rfc2388/ | 2021-01-06 13:40 | - | |
| cl-reversi/ | 2020-10-29 13:05 | - | |
| cl-regex/ | 2024-02-29 07:53 | - | |
| cl-quri/ | 2021-01-06 07:55 | - | |
| cl-qmynd/ | 2021-01-06 07:55 | - | |
| cl-py-configparser/ | 2021-01-06 01:40 | - | |
| cl-puri/ | 2020-10-29 05:18 | - | |
| cl-pubmed/ | 2022-11-06 11:23 | - | |
| cl-ptester/ | 2018-05-07 14:13 | - | |
| cl-ppcre/ | 2022-04-30 10:25 | - | |
| cl-postoffice/ | 2015-04-30 21:21 | - | |
| cl-postmodern/ | 2024-07-29 08:51 | - | |
| cl-portable-aserve/ | 2024-07-29 08:51 | - | |
| cl-plus-ssl/ | 2024-11-01 03:17 | - | |
| cl-plplot/ | 2016-10-31 20:46 | - | |
| cl-pipes/ | 2022-11-06 11:23 | - | |
| cl-photo/ | 2022-11-06 11:23 | - | |
| cl-pg/ | 2022-11-06 11:23 | - | |
| cl-parse-number/ | 2021-01-06 01:40 | - | |
| cl-nibbles/ | 2022-07-24 11:42 | - | |
| cl-named-readtables/ | 2020-12-30 07:34 | - | |
| cl-mustache/ | 2021-01-07 07:45 | - | |
| cl-mssql/ | 2021-01-06 13:40 | - | |
| cl-modlisp/ | 2022-11-06 11:23 | - | |
| cl-metatilities-base/ | 2021-01-05 07:40 | - | |
| cl-metabang-bind/ | 2022-07-24 11:42 | - | |
| cl-memstore/ | 2011-10-19 22:04 | - | |
| cl-md5/ | 2022-04-30 10:25 | - | |
| cl-mcclim/ | 2018-02-25 07:18 | - | |
| cl-markdown/ | 2021-01-05 13:24 | - | |
| cl-lw-compat/ | 2018-05-22 02:18 | - | |
| cl-lparallel/ | 2021-01-06 01:40 | - | |
| cl-log/ | 2024-06-28 02:55 | - | |
| cl-local-time/ | 2021-01-06 01:40 | - | |
| cl-lml2/ | 2022-11-06 11:23 | - | |
| cl-lml/ | 2022-11-06 11:23 | - | |
| cl-lexer/ | 2016-04-27 14:09 | - | |
| cl-launch/ | 2021-01-05 07:40 | - | |
| cl-kmrcl/ | 2021-12-23 10:58 | - | |
| cl-ixf/ | 2021-01-06 13:40 | - | |
| cl-iterate/ | 2022-07-24 11:42 | - | |
| cl-ironclad/ | 2024-11-01 03:17 | - | |
| cl-irc/ | 2022-05-25 13:48 | - | |
| cl-irc-logger/ | 2024-05-03 10:41 | - | |
| cl-interpol/ | 2022-07-27 13:33 | - | |
| cl-ieee-floats/ | 2021-01-06 07:55 | - | |
| cl-hyperobject/ | 2020-10-29 13:05 | - | |
| cl-heredoc/ | 2021-04-30 03:05 | - | |
| cl-graph/ | 2021-01-08 07:53 | - | |
| cl-global-vars/ | 2021-12-12 08:17 | - | |
| cl-github-v3/ | 2021-01-07 13:18 | - | |
| cl-getopt/ | 2023-10-27 03:38 | - | |
| cl-garbage-pools/ | 2021-01-06 07:55 | - | |
| cl-ftp/ | 2021-01-08 02:15 | - | |
| cl-flexichain/ | 2016-11-01 09:18 | - | |
| cl-fiveam/ | 2020-11-27 07:28 | - | |
| cl-fiasco/ | 2023-02-06 20:35 | - | |
| cl-fftw3/ | 2020-10-29 13:05 | - | |
| cl-fad/ | 2022-04-30 10:25 | - | |
| cl-esrap/ | 2022-07-24 11:42 | - | |
| cl-dynamic-classes/ | 2021-01-05 13:24 | - | |
| cl-drakma/ | 2022-07-24 11:42 | - | |
| cl-db3/ | 2020-06-11 01:13 | - | |
| cl-daemon/ | 2021-01-08 02:15 | - | |
| cl-cxml/ | 2021-01-06 07:55 | - | |
| cl-curry-compose-reader-macros/ | 2021-01-08 02:15 | - | |
| cl-csv/ | 2020-10-29 05:18 | - | |
| cl-contextl/ | 2022-04-30 10:25 | - | |
| cl-containers/ | 2021-01-05 07:40 | - | |
| cl-command-line-arguments/ | 2021-01-06 01:40 | - | |
| cl-clx-sbcl/ | 2022-12-28 02:09 | - | |
| cl-cluck/ | 2020-10-29 13:05 | - | |
| cl-closure-common/ | 2021-01-06 07:55 | - | |
| cl-closer-mop/ | 2022-04-30 10:25 | - | |
| cl-chunga/ | 2022-04-30 10:25 | - | |
| cl-chipz/ | 2022-04-30 10:25 | - | |
| cl-base64/ | 2020-10-29 05:18 | - | |
| cl-babel/ | 2022-07-24 11:42 | - | |
| cl-awk/ | 2016-04-27 14:09 | - | |
| cl-asdf/ | 2022-11-06 11:23 | - | |
| cl-asdf-system-connections/ | 2021-01-06 01:40 | - | |
| cl-asdf-flv/ | 2021-01-03 01:34 | - | |
| cl-asdf-finalizers/ | 2021-01-06 01:40 | - | |
| cl-anaphora/ | 2022-07-24 11:42 | - | |
| cl-alexandria/ | 2024-07-27 02:56 | - | |
| cl-abnf/ | 2022-07-24 11:42 | - | |
| cksfv/ | 2022-07-24 11:42 | - | |
| ckport/ | 2022-11-06 11:23 | - | |
| ckon/ | 2024-04-06 21:48 | - | |
| ckermit/ | 2024-11-01 03:26 | - | |
| ckeditor3/ | 2020-12-30 07:34 | - | |
| ckeditor/ | 2023-08-03 20:37 | - | |
| ckbuilder/ | 2023-05-27 01:34 | - | |
| ckb-next/ | 2024-04-06 21:48 | - | |
| ckanclient/ | 2015-12-04 13:35 | - | |
| ck/ | 2024-05-09 19:31 | - | |
| cjson/ | 2024-06-25 15:14 | - | |
| cjs/ | 2024-11-01 03:26 | - | |
| cjose/ | 2024-05-09 19:31 | - | |
| cjk/ | 2022-07-24 11:42 | - | |
| cjet/ | 2024-04-08 18:16 | - | |
| civicrm/ | 2024-01-11 09:10 | - | |
| civetweb/ | 2024-07-20 13:51 | - | |
| citus/ | 2020-07-14 22:44 | - | |
| citeproc-py/ | 2024-01-11 03:14 | - | |
| citation-style-language-styles/ | 2024-05-03 10:41 | - | |
| citation-style-language-locales/ | 2024-05-03 10:41 | - | |
| citar/ | 2024-07-27 09:02 | - | |
| citadel/ | 2022-07-24 11:42 | - | |
| citadel-client/ | 2024-05-09 19:31 | - | |
| ciso/ | 2022-03-04 02:32 | - | |
| cisco7crack/ | 2023-07-26 07:29 | - | |
| cirkuit/ | 2020-07-11 05:52 | - | |
| circuslinux/ | 2024-01-25 13:45 | - | |
| circus/ | 2020-01-14 08:15 | - | |
| circuits/ | 2024-05-06 17:14 | - | |
| circuit-macros/ | 2024-01-11 15:31 | - | |
| circos/ | 2020-07-14 22:44 | - | |
| circos-tools/ | 2018-11-09 16:45 | - | |
| circlator/ | 2024-01-13 09:09 | - | |
| circe/ | 2024-07-27 09:02 | - | |
| cipux/ | 2016-11-01 16:14 | - | |
| cipux-task/ | 2018-01-22 16:53 | - | |
| cipux-storage/ | 2016-11-01 16:16 | - | |
| cipux-rpc/ | 2016-11-01 16:16 | - | |
| cipux-rpc-client/ | 2015-07-24 13:13 | - | |
| cipux-rbac-simple/ | 2016-11-01 16:14 | - | |
| cipux-passwd/ | 2015-07-24 13:13 | - | |
| cipux-object/ | 2016-11-01 16:16 | - | |
| cipux-dog/ | 2016-11-01 09:14 | - | |
| cipux-cat-web/ | 2015-07-24 13:13 | - | |
| ciphersaber/ | 2023-10-27 03:38 | - | |
| ciopfs/ | 2024-04-11 08:50 | - | |
| cinnamon/ | 2024-11-01 01:14 | - | |
| cinnamon-translations/ | 2024-11-01 03:17 | - | |
| cinnamon-settings-daemon/ | 2024-07-05 21:09 | - | |
| cinnamon-session/ | 2024-11-01 01:14 | - | |
| cinnamon-screensaver/ | 2024-11-01 03:26 | - | |
| cinnamon-menus/ | 2024-07-08 03:14 | - | |
| cinnamon-desktop/ | 2024-11-01 03:26 | - | |
| cinnamon-desktop-environment/ | 2024-09-22 14:47 | - | |
| cinnamon-control-center/ | 2024-07-20 07:42 | - | |
| cinfony/ | 2020-12-30 07:34 | - | |
| cinder-tempest-plugin/ | 2024-11-01 03:17 | - | |
| cimg/ | 2024-01-11 03:14 | - | |
| cimfomfa/ | 2024-04-23 00:59 | - | |
| cil/ | 2018-11-09 16:27 | - | |
| cigi-ccl/ | 2020-07-14 22:44 | - | |
| cifxom/ | 2021-12-22 02:14 | - | |
| ciftools-java/ | 2024-05-03 10:41 | - | |
| ciftilib/ | 2024-04-07 20:50 | - | |
| cifer/ | 2020-12-30 07:34 | - | |
| cif2hkl/ | 2023-10-27 09:02 | - | |
| cif2cell/ | 2024-02-15 20:30 | - | |
| cif-tools/ | 2024-11-01 01:14 | - | |
| cif-api/ | 2024-01-13 09:09 | - | |
| cidr/ | 2024-08-06 15:07 | - | |
| ciderwebmail/ | 2023-08-14 07:24 | - | |
| cider/ | 2024-07-26 20:18 | - | |
| ciborium/ | 2018-06-22 23:13 | - | |
| chuffed/ | 2024-05-09 19:31 | - | |
| chuck/ | 2024-11-01 03:26 | - | |
| cht.sh/ | 2023-12-17 08:57 | - | |
| chrpath/ | 2024-11-01 03:26 | - | |
| chrootuid/ | 2023-10-27 09:02 | - | |
| chrony/ | 2020-07-11 05:52 | - | |
| chronicle/ | 2021-01-06 07:55 | - | |
| chron/ | 2024-01-11 09:10 | - | |
| chromono/ | 2021-11-09 14:17 | - | |
| chromium-bsu/ | 2022-02-03 14:03 | - | |
| chromium-browser/ | 2024-04-08 15:02 | - | |
| chromimpute/ | 2024-01-27 13:24 | - | |
| chromhmm/ | 2024-02-15 20:30 | - | |
| chrome-gnome-shell/ | 2020-07-13 16:51 | - | |
| chromaprint/ | 2024-08-04 15:00 | - | |
| chroma/ | 2024-05-09 18:40 | - | |
| christianriesen-otp/ | 2024-08-16 21:17 | - | |
| christianriesen-base32/ | 2024-08-14 20:27 | - | |
| chr/ | 2024-06-01 20:43 | - | |
| choreonoid/ | 2020-07-14 22:44 | - | |
| chordpro/ | 2024-11-01 01:14 | - | |
| chordii/ | 2020-08-11 13:28 | - | |
| choqok/ | 2024-05-09 19:31 | - | |
| choosewm/ | 2024-04-06 21:48 | - | |
| chocolate-doom/ | 2024-08-06 20:31 | - | |
| chntpw/ | 2024-10-09 20:59 | - | |
| chmlib/ | 2024-11-01 03:25 | - | |
| chm2pdf/ | 2018-01-22 16:53 | - | |
| chktex/ | 2024-05-09 19:31 | - | |
| chkservice/ | 2023-08-06 02:04 | - | |
| chkrootkit/ | 2024-11-01 03:26 | - | |
| chkboot/ | 2024-05-26 01:54 | - | |
| chise-base/ | 2024-08-30 15:40 | - | |
| chirp/ | 2024-11-01 03:17 | - | |
| chipw/ | 2018-04-04 03:13 | - | |
| chipmunk/ | 2024-02-16 17:34 | - | |
| chip-seq/ | 2020-04-28 16:37 | - | |
| chinese-calendar/ | 2018-04-04 03:13 | - | |
| chimera2/ | 2016-11-01 09:18 | - | |
| childsplay/ | 2020-12-30 07:34 | - | |
| childsplay-alphabet-sounds-sv/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-sl/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-ru/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-ro/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-pt/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-nl/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-nb/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-it/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-fr/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-es/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-en-gb/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-el/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-de/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-ca/ | 2016-11-01 09:18 | - | |
| childsplay-alphabet-sounds-bg/ | 2016-11-01 09:18 | - | |
| chicken/ | 2024-06-22 09:45 | - | |
| chibicc/ | 2024-07-17 21:23 | - | |
| chibi-scheme/ | 2024-04-26 17:18 | - | |
| chiark-utils/ | 2024-11-01 03:26 | - | |
| chiark-tcl/ | 2024-04-22 23:50 | - | |
| chiark-tcl-applet/ | 2020-06-09 20:13 | - | |
| chiaki/ | 2024-08-01 01:09 | - | |
| chezscheme/ | 2024-11-01 03:26 | - | |
| chez-srfi/ | 2020-11-18 14:15 | - | |
| chewmail/ | 2021-01-07 07:45 | - | |
| chewing-editor/ | 2024-07-05 21:19 | - | |
| chessx/ | 2024-04-06 21:48 | - | |
| chess.app/ | 2024-07-11 21:14 | - | |
| cheshire-clojure/ | 2024-02-15 21:35 | - | |
| cherrytree/ | 2024-04-20 14:52 | - | |
| cherrypy3/ | 2024-11-01 03:19 | - | |
| chemtool/ | 2024-04-06 21:48 | - | |
| chemps2/ | 2024-04-09 02:55 | - | |
| chemonomatopist/ | 2024-07-04 02:57 | - | |
| chemicaltagger/ | 2024-05-06 21:23 | - | |
| chemical-structures/ | 2022-07-24 11:42 | - | |
| chemical-mime-data/ | 2022-07-24 11:42 | - | |
| chemfp/ | 2020-12-30 07:34 | - | |
| chemeq/ | 2023-07-17 14:33 | - | |
| chef/ | 2020-12-30 07:34 | - | |
| chef-zero/ | 2020-12-30 07:34 | - | |
| chef-solr/ | 2018-01-19 17:28 | - | |
| chef-server-webui/ | 2018-01-22 16:53 | - | |
| chef-expander/ | 2018-01-22 16:53 | - | |
| cheetah/ | 2024-04-14 20:45 | - | |
| cheesecutter/ | 2024-08-01 03:09 | - | |
| cheese/ | 2024-09-14 02:16 | - | |
| checkstyle/ | 2022-07-23 16:03 | - | |
| checksec/ | 2024-01-11 09:10 | - | |
| checkpw/ | 2024-05-09 18:39 | - | |
| checkpolicy/ | 2024-11-01 06:00 | - | |
| checkit-tiff/ | 2024-08-11 02:13 | - | |
| checkinstall/ | 2024-11-01 06:00 | - | |
| checkgmail/ | 2016-11-01 16:16 | - | |
| checker-framework-java/ | 2023-11-09 20:39 | - | |
| checkbox/ | 2018-06-23 03:01 | - | |
| checkbot/ | 2021-02-06 02:17 | - | |
| check/ | 2024-06-30 08:25 | - | |
| check-smart-attributes/ | 2024-11-01 02:51 | - | |
| check-postgres/ | 2023-08-08 01:49 | - | |
| check-pgbackrest/ | 2024-07-07 02:09 | - | |
| check-pgactivity/ | 2024-01-11 09:10 | - | |
| check-patroni/ | 2024-06-14 08:49 | - | |
| check-mk/ | 2022-07-20 13:58 | - | |
| check-manifest/ | 2024-05-03 09:55 | - | |
| check-dfsg-status/ | 2024-05-18 07:49 | - | |
| check-all-the-things/ | 2019-12-15 20:33 | - | |
| chealpix/ | 2024-04-05 03:15 | - | |
| chaussette/ | 2021-02-04 02:15 | - | |
| chatty/ | 2024-09-12 20:58 | - | |
| chasquid/ | 2024-10-29 20:47 | - | |
| chasen/ | 2024-04-22 23:50 | - | |
| chase/ | 2024-06-08 20:46 | - | |
| charybdis/ | 2020-12-30 07:34 | - | |
| charts4j/ | 2022-07-24 11:42 | - | |
| chartkick.js/ | 2022-11-06 11:24 | - | |
| charmtimetracker/ | 2024-04-06 21:48 | - | |
| charmap.app/ | 2024-11-01 06:00 | - | |
| charm/ | 2016-11-01 09:18 | - | |
| charm-tools/ | 2016-04-14 20:31 | - | |
| charls/ | 2024-04-21 08:44 | - | |
| charliecloud/ | 2024-06-17 20:54 | - | |
| chardet/ | 2020-12-30 07:34 | - | |
| chardet-whl/ | 2015-03-27 05:43 | - | |
| charactermanaj/ | 2022-04-30 21:50 | - | |
| char-menu-el/ | 2024-07-27 09:02 | - | |
| chaosreader/ | 2023-10-27 03:39 | - | |
| chaosread/ | 2020-12-30 07:34 | - | |
| chaos-marmosets/ | 2024-06-04 02:03 | - | |
| changetrack/ | 2021-12-23 10:58 | - | |
| changeo/ | 2024-11-01 03:17 | - | |
| changeme/ | 2024-07-18 15:16 | - | |
| chameleon-cursor-theme/ | 2020-07-11 05:52 | - | |
| chalow/ | 2021-01-02 01:19 | - | |
| chaksem/ | 2019-12-08 20:15 | - | |
| chake/ | 2024-01-13 09:09 | - | |
| chafa/ | 2024-11-01 06:00 | - | |
| ch5m3d/ | 2023-02-23 01:19 | - | |
| cgview/ | 2021-12-23 10:58 | - | |
| cgvg/ | 2024-11-01 03:18 | - | |
| cgsi-gsoap/ | 2024-08-05 08:11 | - | |
| cgroupfs-mount/ | 2024-05-03 09:56 | - | |
| cgroup-lite/ | 2018-06-22 23:13 | - | |
| cgreen/ | 2024-04-23 20:53 | - | |
| cgoban/ | 2024-05-10 00:00 | - | |
| cgminer/ | 2021-04-29 01:44 | - | |
| cgmanager/ | 2018-06-23 03:01 | - | |
| cglm/ | 2024-05-30 14:09 | - | |
| cglib3/ | 2015-03-03 23:03 | - | |
| cglib/ | 2022-05-31 01:33 | - | |
| cgit/ | 2024-11-01 06:00 | - | |
| cgilib/ | 2022-11-06 13:44 | - | |
| cgif/ | 2024-06-21 15:14 | - | |
| cgiemail/ | 2018-01-23 17:17 | - | |
| cgi-extratags-perl/ | 2016-02-05 08:25 | - | |
| cgdb/ | 2024-07-14 08:10 | - | |
| cgal/ | 2024-11-01 03:22 | - | |
| cg3/ | 2024-02-25 08:57 | - | |
| cfv/ | 2020-12-30 07:34 | - | |
| cftime/ | 2024-06-07 19:58 | - | |
| cfrpki/ | 2024-04-02 15:06 | - | |
| cfourcc/ | 2024-05-09 18:39 | - | |
| cfortran/ | 2021-10-19 07:43 | - | |
| cflow/ | 2024-01-11 09:10 | - | |
| cfitsio3/ | 2018-01-19 17:28 | - | |
| cfitsio/ | 2024-11-01 06:00 | - | |
| cfingerd/ | 2024-05-10 01:50 | - | |
| cfi/ | 2023-01-09 13:24 | - | |
| cfgv/ | 2024-07-25 19:48 | - | |
| cfgrib/ | 2024-11-01 03:18 | - | |
| cfget/ | 2019-10-17 08:15 | - | |
| cffsubr/ | 2024-11-01 03:18 | - | |
| cfflib/ | 2020-12-30 07:34 | - | |
| cffi/ | 2022-08-09 19:34 | - | |
| cfengine3/ | 2024-08-11 14:53 | - | |
| cfengine2/ | 2018-01-23 17:17 | - | |
| cf-python/ | 2017-04-06 14:43 | - | |
| cewl/ | 2024-08-04 08:53 | - | |
| cevomapgen/ | 2024-11-01 03:24 | - | |
| ceve/ | 2016-11-01 16:16 | - | |
| cervisia/ | 2024-04-06 21:48 | - | |
| certspotter/ | 2024-10-25 21:00 | - | |
| certmonger/ | 2024-08-02 07:45 | - | |
| certmaster/ | 2013-12-11 19:53 | - | |
| certipy/ | 2022-11-06 11:23 | - | |
| certinfo/ | 2024-10-25 21:00 | - | |
| cernlib/ | 2020-12-30 07:34 | - | |
| ceres-solver/ | 2024-04-06 21:48 | - | |
| cerealizer/ | 2024-03-02 14:29 | - | |
| cereal/ | 2024-05-03 09:56 | - | |
| ceph/ | 2024-10-19 08:39 | - | |
| ceph-tools/ | 2024-01-13 09:09 | - | |
| ceph-iscsi/ | 2024-03-12 08:42 | - | |
| ceph-deploy/ | 2022-10-21 18:08 | - | |
| centrifuge/ | 2024-11-01 06:00 | - | |
| centreon-plugins/ | 2024-07-21 02:26 | - | |
| centreon-engine/ | 2020-12-30 07:34 | - | |
| centreon-connectors/ | 2022-07-24 11:42 | - | |
| centreon-clib/ | 2021-10-21 08:38 | - | |
| centerim/ | 2016-11-01 16:16 | - | |
| censys/ | 2024-11-01 03:18 | - | |
| cenon.app/ | 2024-07-14 02:53 | - | |
| ceni/ | 2023-06-17 07:29 | - | |
| cen64/ | 2020-07-25 07:23 | - | |
| cen64-qt/ | 2024-04-06 21:48 | - | |
| cellwriter/ | 2022-07-23 16:03 | - | |
| celluloid/ | 2024-07-02 08:41 | - | |
| celestia/ | 2018-01-22 16:53 | - | |
| celery/ | 2024-11-01 01:15 | - | |
| celery-progress/ | 2022-06-14 01:44 | - | |
| celery-haystack/ | 2020-07-14 22:44 | - | |
| celery-haystack-ng/ | 2024-05-03 09:56 | - | |
| celery-batches/ | 2022-07-24 11:42 | - | |
| ceilometer/ | 2024-10-06 02:50 | - | |
| ceilometer-instance-poller/ | 2024-11-01 03:18 | - | |
| cegui-mk2/ | 2024-05-10 00:58 | - | |
| ceferino/ | 2024-01-30 14:10 | - | |
| cedar-backup3/ | 2024-11-01 03:18 | - | |
| cedar-backup2/ | 2020-07-14 22:44 | - | |
| cecilia/ | 2024-11-01 03:18 | - | |
| cecil/ | 2024-11-01 01:15 | - | |
| cecil-flowanalysis/ | 2021-01-07 07:45 | - | |
| cdw/ | 2024-04-07 20:50 | - | |
| cduce/ | 2018-06-22 23:13 | - | |
| cdtool/ | 2021-01-09 08:28 | - | |
| cdsetool/ | 2024-11-01 03:18 | - | |
| cds-healpix-java/ | 2024-11-01 03:18 | - | |
| cdrkit/ | 2024-04-06 03:05 | - | |
| cdrdao/ | 2024-08-10 15:13 | - | |
| cdpr/ | 2024-04-05 15:45 | - | |
| cdparanoia/ | 2024-07-16 04:43 | - | |
| cdogs-sdl/ | 2024-08-05 15:10 | - | |
| cdo/ | 2024-11-01 03:17 | - | |
| cdlclient/ | 2024-11-01 03:18 | - | |
| cdlabelgen/ | 2024-01-11 09:10 | - | |
| cdkr/ | 2022-12-07 08:03 | - | |
| cdk/ | 2023-10-27 03:38 | - | |
| cdist/ | 2024-11-01 03:18 | - | |
| cdiff/ | 2019-10-26 05:15 | - | |
| cdi2iso/ | 2020-04-03 01:56 | - | |
| cdi-api/ | 2021-02-04 13:24 | - | |
| cdftools/ | 2023-10-27 09:02 | - | |
| cdemu-daemon/ | 2024-11-01 05:32 | - | |
| cdemu-client/ | 2024-05-30 14:57 | - | |
| cdecl/ | 2024-04-06 21:48 | - | |
| cdebootstrap/ | 2024-04-05 15:45 | - | |
| cdebconf/ | 2024-08-07 02:23 | - | |
| cdebconf-terminal/ | 2020-12-30 07:34 | - | |
| cdebconf-entropy/ | 2020-12-30 07:34 | - | |
| cde/ | 2021-03-13 20:15 | - | |
| cddlib/ | 2024-04-06 03:05 | - | |
| cdde/ | 2023-10-27 09:02 | - | |
| cdcover/ | 2022-06-15 02:01 | - | |
| cdck/ | 2020-12-30 07:34 | - | |
| cdcd/ | 2024-04-11 08:50 | - | |
| cdcat/ | 2018-04-04 03:13 | - | |
| cdbs/ | 2024-06-25 22:20 | - | |
| cdbfasta/ | 2024-04-23 14:56 | - | |
| cdbackup/ | 2024-11-01 05:32 | - | |
| cdargs/ | 2020-12-30 07:34 | - | |
| cd5/ | 2020-12-30 07:34 | - | |
| cd-hit/ | 2022-07-24 11:42 | - | |
| cd-discid/ | 2022-11-18 18:49 | - | |
| cd-circleprint/ | 2024-11-01 03:18 | - | |
| ccze/ | 2023-12-25 02:06 | - | |
| cctz/ | 2024-11-01 01:15 | - | |
| cctools/ | 2024-08-09 21:10 | - | |
| cctbx/ | 2024-11-01 03:26 | - | |
| cct/ | 2022-07-24 11:42 | - | |
| ccseapps/ | 2018-01-19 17:28 | - | |
| ccrypt/ | 2024-07-27 02:56 | - | |
| cconv/ | 2024-04-24 02:54 | - | |
| ccontrol/ | 2017-07-25 19:18 | - | |
| ccnet/ | 2020-07-13 16:51 | - | |
| ccls/ | 2024-10-09 20:59 | - | |
| cclive/ | 2024-04-07 20:50 | - | |
| cclib/ | 2023-10-27 03:39 | - | |
| cciss-vol-status/ | 2024-05-03 09:56 | - | |
| ccid/ | 2024-11-01 05:32 | - | |
| ccfits/ | 2024-04-21 02:43 | - | |
| ccextractor/ | 2024-08-07 21:07 | - | |
| ccdproc/ | 2024-05-20 14:52 | - | |
| ccdiff/ | 2023-11-10 13:30 | - | |
| ccd2iso/ | 2024-02-18 12:37 | - | |
| cccolutils/ | 2024-04-14 20:45 | - | |
| cccd/ | 2020-04-03 14:13 | - | |
| cccc/ | 2022-11-16 13:48 | - | |
| ccbuild/ | 2024-04-05 15:45 | - | |
| ccache/ | 2024-07-25 15:18 | - | |
| cc1541/ | 2024-04-06 21:48 | - | |
| cc1111/ | 2020-07-13 16:51 | - | |
| cc65/ | 2020-12-30 07:34 | - | |
| cc-tool/ | 2024-01-11 03:14 | - | |
| cc-cedict/ | 2024-11-01 01:15 | - | |
| cbrpager/ | 2020-07-11 05:52 | - | |
| cbp2make/ | 2020-10-29 10:48 | - | |
| cbor2/ | 2024-11-01 05:32 | - | |
| cbootimage/ | 2020-12-30 07:34 | - | |
| cbonsai/ | 2022-11-20 08:19 | - | |
| cbmplugs/ | 2024-04-06 21:48 | - | |
| cbmconvert/ | 2024-08-15 15:47 | - | |
| cbmc/ | 2024-08-04 15:00 | - | |
| cbm/ | 2022-11-06 14:55 | - | |
| cbios/ | 2023-08-05 01:34 | - | |
| cbflib/ | 2024-11-01 05:32 | - | |
| cbatticon/ | 2024-04-11 08:50 | - | |
| cba/ | 2024-04-06 21:48 | - | |
| cb2bib/ | 2024-04-06 21:48 | - | |
| cawbird/ | 2022-08-25 20:34 | - | |
| cavezofphear/ | 2021-01-10 08:00 | - | |
| caveexpress/ | 2023-10-30 18:33 | - | |
| caveconverter/ | 2021-01-01 19:29 | - | |
| cava/ | 2024-02-15 19:32 | - | |
| cava-alsa/ | 2024-06-17 20:54 | - | |
| cauchy/ | 2024-04-22 18:51 | - | |
| catwalk/ | 2014-07-14 07:33 | - | |
| cattle-1.0/ | 2024-04-04 03:19 | - | |
| catools/ | 2016-11-03 21:10 | - | |
| catimg/ | 2022-11-06 14:55 | - | |
| catgirl/ | 2024-11-01 05:32 | - | |
| catfishq/ | 2022-04-30 12:19 | - | |
| catfish/ | 2024-05-31 08:09 | - | |
| catdvi/ | 2024-05-22 14:50 | - | |
| catdoc/ | 2024-04-19 07:30 | - | |
| catcodec/ | 2021-12-19 20:13 | - | |
| catch2/ | 2024-11-01 01:15 | - | |
| catch/ | 2024-05-03 09:56 | - | |
| catatonit/ | 2024-11-01 05:32 | - | |
| cataclysm-dda/ | 2024-07-30 20:38 | - | |
| cat-bat/ | 2024-01-14 03:07 | - | |
| casync/ | 2024-04-06 21:48 | - | |
| castxml/ | 2024-08-24 08:43 | - | |
| castor/ | 2020-07-11 05:52 | - | |
| castle-game-engine/ | 2024-11-01 03:24 | - | |
| castle-combat/ | 2016-11-01 09:19 | - | |
| cassiopee/ | 2024-04-06 21:48 | - | |
| cassbeam/ | 2024-04-06 21:48 | - | |
| caspar/ | 2024-11-01 03:19 | - | |
| cashbox/ | 2024-11-01 03:19 | - | |
| case/ | 2022-05-28 20:18 | - | |
| casacore/ | 2024-11-01 01:15 | - | |
| casacore-data/ | 2019-01-17 14:20 | - | |
| casacore-data-tai-utc/ | 2021-02-03 01:44 | - | |
| casacore-data-sources/ | 2024-11-01 03:19 | - | |
| casacore-data-observatories/ | 2024-11-01 03:19 | - | |
| casacore-data-lines/ | 2022-05-21 07:35 | - | |
| casacore-data-jplde/ | 2020-12-30 07:34 | - | |
| casacore-data-igrf/ | 2018-06-22 23:13 | - | |
| casablanca/ | 2020-07-11 05:52 | - | |
| casa-formats-io/ | 2024-05-09 19:31 | - | |
| carton/ | 2022-05-13 15:21 | - | |
| carrotsearch-randomizedtesting/ | 2023-01-11 07:29 | - | |
| carrotsearch-procfork/ | 2023-01-18 08:37 | - | |
| carrotsearch-hppc/ | 2020-07-11 05:52 | - | |
| carmetal/ | 2023-06-13 02:02 | - | |
| carla/ | 2024-09-26 20:57 | - | |
| carl9170fw/ | 2024-06-06 13:48 | - | |
| caribou/ | 2024-04-07 02:46 | - | |
| cargo/ | 2024-01-13 03:11 | - | |
| carettah/ | 2020-12-30 07:34 | - | |
| caret/ | 2018-01-22 16:53 | - | |
| care/ | 2024-04-11 08:50 | - | |
| cardstories/ | 2015-10-22 12:03 | - | |
| cardpeek/ | 2024-04-06 21:48 | - | |
| cardo/ | 2018-05-05 05:11 | - | |
| carburetor/ | 2024-02-25 14:54 | - | |
| carbon-c-relay/ | 2024-04-05 15:45 | - | |
| car/ | 2024-11-01 03:19 | - | |
| captagent/ | 2020-12-30 07:34 | - | |
| capsule-nextflow/ | 2024-01-11 03:14 | - | |
| capsule-maven-nextflow/ | 2024-01-11 09:10 | - | |
| capstone/ | 2024-04-06 21:48 | - | |
| capstats/ | 2024-04-05 15:45 | - | |
| caps2esc/ | 2022-11-08 02:40 | - | |
| caps/ | 2024-04-19 06:28 | - | |
| cappuccino/ | 2024-07-14 14:37 | - | |
| capnproto/ | 2024-04-25 02:44 | - | |
| capistrano/ | 2024-11-01 03:19 | - | |
| capirca/ | 2024-08-11 02:12 | - | |
| capi4hylafax/ | 2020-04-04 07:54 | - | |
| canu/ | 2023-10-30 18:33 | - | |
| cantor/ | 2024-08-07 21:55 | - | |
| canto/ | 2016-11-01 21:26 | - | |
| cantata/ | 2024-08-13 21:02 | - | |
| canorus/ | 2016-11-01 16:16 | - | |
| canna/ | 2024-09-10 08:53 | - | |
| canna-shion/ | 2024-11-01 03:19 | - | |
| canlock/ | 2024-04-22 23:50 | - | |
| canl-java/ | 2024-01-11 15:31 | - | |
| canl-c/ | 2024-04-19 20:51 | - | |
| canl-c++/ | 2018-01-19 17:28 | - | |
| canid/ | 2024-10-25 21:00 | - | |
| caneda/ | 2024-11-01 05:32 | - | |
| candid/ | 2018-04-25 02:24 | - | |
| canadian-ham-exam/ | 2023-01-29 02:33 | - | |
| can-utils/ | 2023-05-02 09:54 | - | |
| camv-rnd/ | 2024-08-25 20:46 | - | |
| camping/ | 2024-08-28 08:02 | - | |
| campania/ | 2019-11-15 20:16 | - | |
| camp/ | 2024-04-05 09:26 | - | |
| camorama/ | 2018-01-23 17:17 | - | |
| camomile/ | 2024-09-12 08:53 | - | |
| camo/ | 2024-11-01 01:16 | - | |
| camlzip/ | 2024-09-12 08:53 | - | |
| camltemplate/ | 2024-09-12 08:53 | - | |
| camlpdf/ | 2024-09-12 08:53 | - | |
| camlp5/ | 2024-09-21 02:49 | - | |
| camlp5-buildscripts/ | 2024-09-21 02:49 | - | |
| camlp4/ | 2024-08-10 13:52 | - | |
| camlp-streams/ | 2024-08-09 21:53 | - | |
| camlmix/ | 2024-06-15 19:58 | - | |
| camljava/ | 2024-09-12 08:53 | - | |
| camlimages/ | 2024-09-19 14:54 | - | |
| camlidl/ | 2024-08-09 21:53 | - | |
| camlidl-doc/ | 2020-07-24 01:39 | - | |
| camldbm/ | 2014-02-18 23:09 | - | |
| camlbz2/ | 2024-09-12 08:53 | - | |
| caml2html/ | 2024-08-10 18:31 | - | |
| caml-mode/ | 2024-07-26 20:20 | - | |
| caml-crush/ | 2024-06-27 08:12 | - | |
| camitk/ | 2024-06-24 15:08 | - | |
| camgrab/ | 2016-11-01 09:19 | - | |
| cameramonitor/ | 2015-04-30 21:21 | - | |
| camera.app/ | 2024-07-11 15:23 | - | |
| camera-app/ | 2018-06-22 23:13 | - | |
| camelot-py/ | 2024-05-21 01:44 | - | |
| cam2ip/ | 2024-07-17 09:00 | - | |
| cam/ | 2016-10-31 20:46 | - | |
| calypso/ | 2022-07-23 16:03 | - | |
| callisto/ | 2024-05-28 07:59 | - | |
| calligraplan/ | 2024-04-06 21:48 | - | |
| calligra/ | 2024-09-19 20:56 | - | |
| calligra-l10n/ | 2018-01-19 17:28 | - | |
| callaudiod/ | 2024-07-03 15:57 | - | |
| calindori/ | 2024-04-06 21:48 | - | |
| california/ | 2020-07-11 05:52 | - | |
| calife/ | 2020-12-30 07:34 | - | |
| calibre/ | 2024-11-01 03:23 | - | |
| calf/ | 2024-04-06 21:48 | - | |
| calendarsupport/ | 2024-11-01 01:15 | - | |
| calendarserver/ | 2020-12-30 07:34 | - | |
| calendar/ | 2024-09-19 08:45 | - | |
| caldav-tester/ | 2020-11-10 08:16 | - | |
| calcurse/ | 2023-11-12 02:09 | - | |
| calculix-cgx/ | 2024-04-17 14:58 | - | |
| calculix-ccx/ | 2024-04-11 08:50 | - | |
| calculix-ccx-test/ | 2022-05-21 07:35 | - | |
| calculix-ccx-doc/ | 2022-05-21 07:35 | - | |
| calcoo/ | 2020-12-30 07:34 | - | |
| calcium/ | 2024-01-14 03:07 | - | |
| calc/ | 2024-04-06 21:48 | - | |
| calc-stats/ | 2017-10-13 02:17 | - | |
| calamaris/ | 2023-06-29 19:53 | - | |
| calamares/ | 2024-10-31 14:49 | - | |
| calamares-settings-ubuntu/ | 2024-10-30 14:41 | - | |
| calamares-settings-mobian/ | 2024-11-01 01:16 | - | |
| calamares-settings-debian/ | 2024-11-01 01:16 | - | |
| calamares-extensions/ | 2024-04-06 21:48 | - | |
| calabash/ | 2020-04-01 08:22 | - | |
| cal3d/ | 2024-11-01 05:32 | - | |
| cal/ | 2024-11-01 05:32 | - | |
| cakephp/ | 2024-01-11 09:10 | - | |
| cakephp-instaweb/ | 2018-01-22 16:53 | - | |
| cajun/ | 2014-10-25 08:01 | - | |
| caja/ | 2024-04-09 02:55 | - | |
| caja-seahorse/ | 2024-04-16 14:59 | - | |
| caja-rename/ | 2024-06-11 20:51 | - | |
| caja-mediainfo/ | 2022-07-24 11:42 | - | |
| caja-extensions/ | 2024-04-07 20:50 | - | |
| caja-eiciel/ | 2024-04-07 20:50 | - | |
| caja-admin/ | 2023-09-11 02:09 | - | |
| caja-actions/ | 2024-04-06 21:48 | - | |
| cairosvg/ | 2023-08-13 08:27 | - | |
| cairomm1.16/ | 2024-01-12 03:18 | - | |
| cairodevice/ | 2022-07-24 11:42 | - | |
| cairocffi/ | 2024-07-10 03:01 | - | |
| cairo/ | 2023-01-03 08:38 | - | |
| cairo-ocaml/ | 2024-09-12 08:53 | - | |
| cairo-dock/ | 2024-04-06 21:48 | - | |
| cairo-dock-plug-ins/ | 2024-04-06 21:48 | - | |
| cairo-clock/ | 2016-11-01 09:19 | - | |
| cairo-5c/ | 2024-04-22 18:51 | - | |
| cain/ | 2020-12-30 07:34 | - | |
| cagibi/ | 2015-12-04 13:35 | - | |
| cage/ | 2024-04-10 15:02 | - | |
| caffeine/ | 2024-01-11 03:14 | - | |
| caffeine-cache/ | 2021-01-10 01:51 | - | |
| caffe/ | 2022-07-24 11:42 | - | |
| cafeobj/ | 2022-07-19 21:16 | - | |
| cadvisor/ | 2022-07-24 11:42 | - | |
| cadubi/ | 2023-01-22 02:32 | - | |
| cado/ | 2023-07-05 02:30 | - | |
| cadical/ | 2024-02-15 23:44 | - | |
| cadencii/ | 2023-11-22 01:32 | - | |
| caddy/ | 2024-10-25 21:00 | - | |
| cadaver/ | 2024-05-31 01:49 | - | |
| cadabra2/ | 2024-01-26 20:45 | - | |
| cadabra/ | 2022-11-06 14:55 | - | |
| cactoos/ | 2022-11-06 11:23 | - | |
| cacti/ | 2024-08-21 20:57 | - | |
| cacti-spine/ | 2024-11-01 05:32 | - | |
| cackey/ | 2021-11-08 04:43 | - | |
| cachy/ | 2022-07-24 11:42 | - | |
| cachey/ | 2023-08-17 08:29 | - | |
| cachelib/ | 2024-05-03 09:56 | - | |
| cachefilesd/ | 2024-05-10 01:50 | - | |
| cached-property/ | 2020-12-30 07:34 | - | |
| cached-ipaddress/ | 2024-11-01 05:32 | - | |
| cableswig/ | 2018-01-22 16:53 | - | |
| cabextract/ | 2024-04-04 05:11 | - | |
| cabal-debian/ | 2024-11-01 06:00 | - | |
| ca-certificates/ | 2021-12-23 10:58 | - | |
| ca-cacert/ | 2020-12-30 07:34 | - | |
| c2050/ | 2021-10-23 14:14 | - | |
| c3p0/ | 2024-03-23 01:13 | - | |
| c3/ | 2021-01-14 20:22 | - | |
| c2x/ | 2024-02-04 15:00 | - | |
| c2hs/ | 2022-07-24 11:42 | - | |
| c2go/ | 2024-11-01 05:32 | - | |
| c2esp/ | 2023-08-25 21:33 | - | |
| c-vtapi/ | 2024-04-05 15:45 | - | |
| c-sig/ | 2024-07-27 09:02 | - | |
| c-repl/ | 2016-11-01 02:29 | - | |
| c-munipack/ | 2024-05-09 18:39 | - | |
| c-icap/ | 2024-04-06 21:48 | - | |
| c-icap-modules/ | 2024-11-01 05:32 | - | |
| c-graph/ | 2020-12-30 07:34 | - | |
| c-evo-dh/ | 2024-11-01 03:25 | - | |
| c-cpp-reference/ | 2015-04-30 21:21 | - | |
| c-blosc2/ | 2024-08-01 21:14 | - | |
| c-blosc/ | 2024-04-20 20:48 | - | |
| c++-annotations/ | 2024-11-01 03:19 | - | |
curl -O https://mirror.coganng.com/addRepo.sh && sudo bash addRepo.shinto any bash Terminal. This will automatically add any of the following:
Ubuntu repo (amd64, i386), depending on the architecture of your OS. This should just work without any issues, and will choose the nearest mirror server to the server's location. If there are any issues or if you wish to restore the original sources.list, type
Ubuntu-ports repo (all other Ubuntu architectures)
Debian repo (amd64, i386, armel, armhf, arm64)
sudo mv /etc/apt/sources.list.tibak /etc/apt/sources.list
Note that you do not need to download any other addRepo-*.sh file. The addRepo.sh main script will do it for you.